
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 613-30-9 |
| Catalog No. | 2A-9086355 |
| Chinese Name | 2-甲基-6-硝基喹啉 |
| Synonyms | MFCD00051736; 2-methyl-6-nitroquinoline |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.187 |
| Purity | 98.00 |
| Density | 1.298 g/cm3 |
| Boiling Point | 334.7ºC at 760 mmHg |
| Melting Point | 165 °C |
| Appearance | Solid;White to Light yellow to Light orange powder to crystal |
| Storage Condition | Storage: Seal the container and store it in a seal |
| HTC | 2933499090 |
| MDL Number | MFCD00051736 |
| SMILES | Cc1ccc2cc([N+](=O)[O-])ccc2n1 |
| InChI | InChI=1S/C10H8N2O2/c1-7-2-3-8-6-9(12(13)14)4-5-10(8)11-7/h2-6H,1H3 |
| InChI Key | DXDPHHQJZWWAEH-UHFFFAOYSA-N |
| MSDS | msds/86355_1_613_30_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards 2-Methyl-6-nitroquinoline Modification number: 5 Module 14. Shipping information UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| Ethyl1,2-dihydronaphtho[2,1-b]furan-2-carboxylate | 62019-34-5 | 2A-9086318 |
| 4-Methylthiazole-2-thiol | 4498-39-9 | 2A-9086331 |
| Ethyl5-(Methylsulfonyl)pyridine-2-carboxylate | 918967-32-5 | 2A-9086345 |
| 3,4-Dibromo-5-phenyl-2(5H)-furanone | 72857-86-4 | 2A-9086346 |
| 3-(1-Nitroethyl)-2-benzofuran-1(3H)-one | 79017-08-6 | 2A-9086351 |
| 5,6-Methylenedioxy-2-phenylindole | 64943-90-4 | 2A-9086361 |
| 2-Amino-3,5-dibromo-6-chloropyrazine | 566205-01-4 | 2A-9086362 |
| Dibenzofuran-2-sulfonicacid | 83863-63-2 | 2A-9086374 |
| 1-Acetyl-4-iodo-1H-pyrazole | 98027-52-2 | 2A-9086381 |
| 5,6-Difluoroindoline-2,3-dione | 774-47-0 | 2A-9086391 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA