
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4498-39-9 |
| Catalog No. | 2A-9086331 |
| Chinese Name | 4-甲基噻唑-2-硫酮 |
| Synonyms | MFCD00798571; 2-Mercapto-4-methylthiazole; 4-METHYL-1,3-THIAZOLE-2-THIOL |
| Molecular Formula | C4H5N1S2 |
| Molecular Weight | 131.22 |
| Density | 1.36g/cm3 |
| Boiling Point | 203.4ºC at 760mmHg |
| Melting Point | 86-89℃ |
| Storage Condition | Keep away from light, in a ventilated and dry plac |
| HTC | 2934100090 |
| MDL Number | MFCD01924761 |
| SMILES | CC1=CSC(=S)N1 |
| InChI | InChI=1S/C4H5NS2/c1-3-2-7-4(6)5-3/h2H,1H3,(H,5,6) |
| InChI Key | InChIKey=NLHAIPFBNQZTMY-UHFFFAOYSA-N |
| MSDS | msds/86331_1_4498_39_9.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 2-(Hydroxymethyl)homomorpholine | 1207254-23-6 | 2A-9086290 |
| 2-Benzenesulfonylthiophene | 22407-40-5 | 2A-9086294 |
| Furan-2-Ylmethyl-(2-Methoxy-Benzyl)-Amine | 225236-02-2 | 2A-9086297 |
| 7-Chloroquinazoline-2,4(1H,3H)-dione | 13165-35-0 | 2A-9086299 |
| Ethyl1,2-dihydronaphtho[2,1-b]furan-2-carboxylate | 62019-34-5 | 2A-9086318 |
| Ethyl5-(Methylsulfonyl)pyridine-2-carboxylate | 918967-32-5 | 2A-9086345 |
| 3,4-Dibromo-5-phenyl-2(5H)-furanone | 72857-86-4 | 2A-9086346 |
| 3-(1-Nitroethyl)-2-benzofuran-1(3H)-one | 79017-08-6 | 2A-9086351 |
| 2-Methyl-6-nitroquinoline | 613-30-9 | 2A-9086355 |
| 5,6-Methylenedioxy-2-phenylindole | 64943-90-4 | 2A-9086361 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA