CAS Number7335-25-3
SynonymsBenzoic acid, 2-chloro-, ethyl ester; MFCD00016338; EINECS 230-842-6; Ethyl 2-chlorobenzoate
Molecular FormulaC9H9O2Cl1
Molecular Weight184.62
Density1.2±0.1 g/cm3
Boiling Point243.6±13.0 °C at 760 mmHg
AppearanceColorless - almost colorless clear liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7335-25-3 |
| Catalog No. | 2A-9086349 |
| Chinese Name | 2-氯苯甲酸乙酯 |
| Synonyms | Benzoic acid, 2-chloro-, ethyl ester; MFCD00016338; EINECS 230-842-6; Ethyl 2-chlorobenzoate |
| Molecular Formula | C9H9O2Cl1 |
| Molecular Weight | 184.62 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 243.6±13.0 °C at 760 mmHg |
| Appearance | Colorless - almost colorless clear liquid |
| Storage Condition | Sealed and stored in a cool, dry environment. |
| HTC | 2916399090 |
| MDL Number | MFCD00016338 |
| SMILES | CCOC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C9H9ClO2/c1-2-12-9(11)7-5-3-4-6-8(7)10/h3-6H,2H2,1H3 |
| InChI Key | RETLCWPMLJPOTP-UHFFFAOYSA-N |
| MSDS | msds/86349_1_7335_25_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Amino-3-cyclohexylpropionicacid | 129042-71-3 | 2A-9086341 |
| Ethyl2-Nitro-4,5-di(1-pyrazolyl)benzoate | 1256633-25-6 | 2A-9086342 |
| Picrolonicacid | 550-74-3 | 2A-9086344 |
| 2-Amino-3-bromo-5-methylbenzoicacid | 13091-43-5 | 2A-9086347 |
| 2-(3-Methoxyphenoxy)propionicAcid | 7309-52-6 | 2A-9086348 |
| N-Amyl4-aminobenzoate | 13110-37-7 | 2A-9086352 |
| N,N-Di-N-Propyl-L-alanine | 81854-56-0 | 2A-9086353 |
| Ethyl3-chloro-4-methylcarbanilate | 85419-40-5 | 2A-9086356 |
| 6-Aza-2-thiothymine | 615-76-9 | 2A-9086357 |
| Ethyl2-isocyanato-3-phenylpropionate | 87543-80-4 | 2A-9086358 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS