
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7309-52-6 |
| Catalog No. | 2A-9086348 |
| Chinese Name | 2-(3-甲氧基苯氧基)丙酸 |
| Synonyms | 2-(2-(TRIFLUOROMETHYL)PHENYL)BENZOIC ACID; 2-(3-Methoxyphenoxy)propionic Acid; F3308-2722 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20000 |
| Density | 1.185g/cm3 |
| Boiling Point | 329.7ºC at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2918990090 |
| SMILES | COc1cccc(OC(C)C(=O)O)c1 |
| InChI | InChI=1S/C10H12O4/c1-7(10(11)12)14-9-5-3-4-8(6-9)13-2/h3-7H,1-2H3,(H,11,12) |
| InChI Key | QAVOEPJGKZAZIG-UHFFFAOYSA-N |
| MSDS | msds/86348_1_7309_52_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Hydroxy-3-isopropylbenzoicacid | 7053-88-5 | 2A-0201378 |
| 3-Amino-3-cyclohexylpropionicacid | 129042-71-3 | 2A-9086341 |
| Ethyl2-Nitro-4,5-di(1-pyrazolyl)benzoate | 1256633-25-6 | 2A-9086342 |
| Picrolonicacid | 550-74-3 | 2A-9086344 |
| 2-Amino-3-bromo-5-methylbenzoicacid | 13091-43-5 | 2A-9086347 |
| 2-Chlorobenzoicacidethylester | 7335-25-3 | 2A-9086349 |
| N-Amyl4-aminobenzoate | 13110-37-7 | 2A-9086352 |
| N,N-Di-N-Propyl-L-alanine | 81854-56-0 | 2A-9086353 |
| Ethyl3-chloro-4-methylcarbanilate | 85419-40-5 | 2A-9086356 |
| 6-Aza-2-thiothymine | 615-76-9 | 2A-9086357 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA