
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 84145-17-5 |
| Catalog No. | 2A-9086192 |
| Chinese Name | 全氟戊酸烯丙酯 |
| Synonyms | EINECS 282-241-3; Allyl perfluorovalerate; Allyl perfluoropentanoate |
| Molecular Formula | C8H5F9O2 |
| Molecular Weight | 304.11000 |
| Density | 1.459g/cm3 |
| Boiling Point | 69ºC 90mm |
| Storage Condition | room temperature |
| HTC | 2915900090 |
| SMILES | C=CCOC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H5F9O2/c1-2-3-19-4(18)5(9,10)6(11,12)7(13,14)8(15,16)17/h2H,1,3H2 |
| InChI Key | OUJAXDQRZMGUOM-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4'-(2-Acetoxyethoxy)acetophenone | 75230-41-0 | 2A-9086187 |
| Methyl2-Carbamoylbenzoate | 90564-02-6 | 2A-9086188 |
| Ethyl4-nitrobenzoylacetate | 838-57-3 | 2A-9086189 |
| 2-Chloro-1-(4-pyridinyl)ethanoneHydrochloride | 25260-36-0 | 2A-9086190 |
| Methyl2-Acetamido-2-phenylacetate | 36061-00-4 | 2A-9086191 |
| 4-Formyl-3-methoxy-phenoxyaceticacid | 84969-24-4 | 2A-9086194 |
| 9-Fluorenylmethylpentafluorophenylcarbonate | 88744-04-1 | 2A-0200942 |
| Methyl2-(1-Methyl-4-piperidyl)acetate | 95533-25-8 | 2A-9086197 |
| o-Tert-Butyl-n-4-nitrophenylcarbazate | 92491-67-3 | 2A-9086199 |
| Ethyl(2-methylphenoxy)acetate | 93917-68-1 | 2A-9086201 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA