
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 75230-41-0 |
| Catalog No. | 2A-9086187 |
| Chinese Name | 二乙酰苯乙酮 |
| Synonyms | 4'-(2-acetoxyethoxy)acetophenone |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 288.30 |
| Density | 1.122g/cm3 |
| Boiling Point | 338.6ºC at 760 mmHg |
| Melting Point | 64ºC |
| Appearance | solid |
| Storage Condition | Store in an airtight container in a cool, dry plac |
| HTC | 2915390090 |
| PubChem ID | 329815582 |
| MDL Number | MFCD00597841 |
| SMILES | COc1ccc(CC(=O)c2ccc(O)cc2O)cc1OC |
| InChI | 1S/C16H16O5/c1-20-15-6-3-10(8-16(15)21-2)7-13(18)12-5-4-11(17)9-14(12)19/h3-6,8-9,17,19H,7H2,1-2H3 |
| InChI Key | LRXMMYWDVBYTPO-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/86187_1_75230_41_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Inspection | R. Imported food hygiene supervision and inspection S. Export food hygiene supervision and inspection M. Imported commodity inspection N. Exported commodity inspection |
| Transport Info | Product name: Supervision conditions A. Customs clearance form for inbound goods B. Customs clearance form for outbound goods |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| N-(Phenylsulfonyl)glycineMethylEster | 69398-48-7 | 2A-9086178 |
| 1-Chloro-4-(2-hydroxyethoxy)benzene | 1892-43-9 | 2A-9086180 |
| Ethylbis(ethylthio)acetate | 20461-95-4 | 2A-9086182 |
| N-Acryloylsarcosinemethylester | 72065-23-7 | 2A-9086184 |
| 2-AcetamidobenzylAlcohol | 20939-77-9 | 2A-9086185 |
| Methyl2-Carbamoylbenzoate | 90564-02-6 | 2A-9086188 |
| Ethyl4-nitrobenzoylacetate | 838-57-3 | 2A-9086189 |
| 2-Chloro-1-(4-pyridinyl)ethanoneHydrochloride | 25260-36-0 | 2A-9086190 |
| Methyl2-Acetamido-2-phenylacetate | 36061-00-4 | 2A-9086191 |
| Allylperfluoropentanoate | 84145-17-5 | 2A-9086192 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA