CAS Number4743-82-2
Synonyms3-Acetylacrylic acid; Acetacrylsaeure; 4-OXOPENT-2-ENOIC ACID; EINECS 225-256-2; dehydrolevulinic acid; 3-acetyl acrylic acid; ACETYL ACRYLIC ACID; MFCD00014016; 4-Oxo-2-pentenoic acid; 4-oxo-2-pentenoicaci
Molecular FormulaC5H6O3
Molecular Weight114.09900
Purity97.00%
Density1.183g/cm3
Boiling Point269.7ºC at 760 mmHg
Melting Point123-124ºC
AppearanceLight yellow powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4743-82-2 |
| Catalog No. | 2A-9086144 |
| Chinese Name | 3-乙酰基丙烯酸 |
| Synonyms | 3-Acetylacrylic acid; Acetacrylsaeure; 4-OXOPENT-2-ENOIC ACID; EINECS 225-256-2; dehydrolevulinic acid; 3-acetyl acrylic acid; ACETYL ACRYLIC ACID; MFCD00014016; 4-Oxo-2-pentenoic acid; 4-oxo-2-pentenoicaci |
| Molecular Formula | C5H6O3 |
| Molecular Weight | 114.09900 |
| Purity | 97.00 |
| Density | 1.183g/cm3 |
| Boiling Point | 269.7ºC at 760 mmHg |
| Melting Point | 123-124ºC |
| Appearance | Light yellow powder |
| Storage Condition | Keep away from light, in a ventilated and dry plac |
| HTC | 2918300090 |
| SMILES | CC(=O)C=CC(=O)O |
| InChI | InChI=1S/C5H6O3/c1-4(6)2-3-5(7)8/h2-3H,1H3,(H,7,8)/b3-2+ |
| InChI Key | XGTKSWVCNVUVHG-NSCUHMNNSA-N |
| MSDS | msds/86144_1_4743_82_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff: 6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4'-Acetoxy-2'-hydroxyacetophenone | 42059-48-3 | 2A-9086137 |
| DiethylN-amylmalonate | 6065-59-4 | 2A-9086139 |
| 9-Fluorenylideneaceticacid | 4425-73-4 | 2A-9086140 |
| Diethyl2-heptylmalonate | 607-83-0 | 2A-9086141 |
| 3-Acetoxybenzoicacid | 6304-89-8 | 2A-9086143 |
| Diethyl2-formylaminomalonate | 6326-44-9 | 2A-9086145 |
| 3-Methylisatoicanhydride | 66176-17-8 | 2A-9086146 |
| Malonicacidbis(4-nitrobenzyl)ester | 67245-85-6 | 2A-9086147 |
| Methyl8-methylnonanoate | 5129-54-4 | 2A-9086148 |
| Diethyl2-ethyl-2-(p-tolyl)malonate | 68692-80-8 | 2A-9086149 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS