
CAS Number4425-73-4
Synonyms9H-fluoren-9-ylideneacetic acid; 9-fluorenylidene acetate; EINECS 224-604-0; Biphenylenecrylic acid; MFCD00040930; fluoren-9-ylidene-acetic acid; 9H-Fluorene-9-ylideneacetic acid; BIPHENYLENEACRYLIC ACID; Fluorenylideneacetic acid; dibenzofulvene-1-carboxylic acid
Molecular FormulaC15H10O2
Molecular Weight222.23900
Density1.387g/cm3
Boiling Point385.7ºC at 760 mmHg
Melting Point231-233ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4425-73-4 |
| Catalog No. | 2A-9086140 |
| Chinese Name | 9-亚芴基乙酸 |
| Synonyms | 9H-fluoren-9-ylideneacetic acid; 9-fluorenylidene acetate; EINECS 224-604-0; Biphenylenecrylic acid; MFCD00040930; fluoren-9-ylidene-acetic acid; 9H-Fluorene-9-ylideneacetic acid; BIPHENYLENEACRYLIC ACID; Fluorenylideneacetic acid; dibenzofulvene-1-carboxylic acid |
| Molecular Formula | C15H10O2 |
| Molecular Weight | 222.23900 |
| Density | 1.387g/cm3 |
| Boiling Point | 385.7ºC at 760 mmHg |
| Melting Point | 231-233ºC |
| Storage Condition | Keep away from light, in a ventilated and dry plac |
| HTC | 2916399090 |
| SMILES | O=C(O)C=C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C15H10O2/c16-15(17)9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-9H,(H,16,17) |
| InChI Key | TUWTVRGEVPWFIX-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Allyltrifluoroacetate | 383-67-5 | 2A-9086131 |
| 3-Acetyl-2H-chromen-2-one | 3949-36-8 | 2A-9086132 |
| 2-Bemzoylxyacetophenone | 4010-33-7 | 2A-9086135 |
| 4'-Acetoxy-2'-hydroxyacetophenone | 42059-48-3 | 2A-9086137 |
| DiethylN-amylmalonate | 6065-59-4 | 2A-9086139 |
| Diethyl2-heptylmalonate | 607-83-0 | 2A-9086141 |
| 3-Acetoxybenzoicacid | 6304-89-8 | 2A-9086143 |
| 3-Acetylacrylicacid | 4743-82-2 | 2A-9086144 |
| Diethyl2-formylaminomalonate | 6326-44-9 | 2A-9086145 |
| 3-Methylisatoicanhydride | 66176-17-8 | 2A-9086146 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA