
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2088-24-6 |
| Catalog No. | 2A-9086126 |
| Chinese Name | 3-甲氧基苯氧基乙酸 |
| Synonyms | (3-Methoxyphenoxy)acetic acid; m-Methoxy phenoxy acetic acid; F1924-0025; MFCD00014357; 3-METHOXYPHENOXYACETIC ACID |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.173 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 325.9±17.0 °C at 760 mmHg |
| Melting Point | 116-117°C |
| Storage Condition | Store in a place to avoid contact with oxidants, s |
| HTC | 2918990090 |
| SMILES | COc1cccc(OCC(=O)O)c1 |
| InChI | InChI=1S/C9H10O4/c1-12-7-3-2-4-8(5-7)13-6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
| InChI Key | AHDPQRIYMMZJTF-UHFFFAOYSA-N |
| MSDS | msds/86126_1_2088_24_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethyl2-Methoxyphenoxyacetate | 13078-21-2 | 2A-9086120 |
| Acetylsalicylicanhydride | 1466-82-6 | 2A-9086121 |
| 9-Phenyl-nonanoicacid | 16269-06-0 | 2A-9086123 |
| 4-Acetylphenoxyaceticacid | 1878-81-5 | 2A-9086124 |
| 2-MethoxyphenoxyaceticAcid | 1878-85-9 | 2A-9086125 |
| Methyl3-benzoylpropionate | 25333-24-8 | 2A-9086127 |
| Ethyl9-bromononanoate | 28598-81-4 | 2A-9086128 |
| N-Butyl4-(4'-Methoxyphenoxycarbonyl)phenylCarbonate | 33926-39-5 | 2A-9086129 |
| 4-(4-Methoxyanilino)-4-oxobut-2-enoicacid | 37902-60-6 | 2A-9086130 |
| Allyltrifluoroacetate | 383-67-5 | 2A-9086131 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA