
CAS Number13078-21-2
Synonymsethyl 2-(2-methoxyphenoxy)acetate; Ethyl (2-methoxyphenoxy)acetate; Acetic acid, (2-methoxyphenoxy)-, ethyl ester; Acetic acid, 2-(2-methoxyphenoxy)-, ethyl ester
Molecular FormulaC11H14O4
Molecular Weight210.23
Density1.1±0.1 g/cm3
Boiling Point278.7±15.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 13078-21-2 |
| Catalog No. | 2A-9086120 |
| Chinese Name | 2-甲氧基苯氧基乙酸乙酯 |
| Synonyms | ethyl 2-(2-methoxyphenoxy)acetate; Ethyl (2-methoxyphenoxy)acetate; Acetic acid, (2-methoxyphenoxy)-, ethyl ester; Acetic acid, 2-(2-methoxyphenoxy)-, ethyl ester |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 278.7±15.0 °C at 760 mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2918990090 |
| MDL Number | MFCD00082657 |
| SMILES | CCOC(=O)COc1ccccc1OC |
| InChI | InChI=1S/C11H14O4/c1-3-14-11(12)8-15-10-7-5-4-6-9(10)13-2/h4-7H,3,8H2,1-2H3 |
| InChI Key | BZCGGCRVJFWCIW-UHFFFAOYSA-N |
| MSDS | msds/86120_1_13078_21_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| O-Carboxyphenylphosphate | 6064-83-1 | 2A-9086111 |
| 3-Ethoxybenzoicacid | 621-51-2 | 2A-9086112 |
| Sedanolide | 6415-59-4 | 2A-9086113 |
| Methyltetronate | 69556-70-3 | 2A-9086117 |
| 4-[4-(2-Carboxybenzoyl)phenyl]butyricacid | 80866-86-0 | 2A-9086119 |
| Acetylsalicylicanhydride | 1466-82-6 | 2A-9086121 |
| 9-Phenyl-nonanoicacid | 16269-06-0 | 2A-9086123 |
| 4-Acetylphenoxyaceticacid | 1878-81-5 | 2A-9086124 |
| 2-MethoxyphenoxyaceticAcid | 1878-85-9 | 2A-9086125 |
| 3-Methoxyphenoxyaceticacid | 2088-24-6 | 2A-9086126 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA