
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 22775-37-7 |
| Catalog No. | 2A-9086092 |
| Chinese Name | 3,5-二氯-2-甲氧基苯甲酸 |
| Synonyms | 3,5-dichloro-2-methoxybenzoic acid |
| Molecular Formula | C8H6O3Cl2 |
| Molecular Weight | 221.04 |
| Density | 1.474g/cm3 |
| Boiling Point | 333.2ºC at 760mmHg |
| Storage Condition | room temperature, dry |
| HTC | 2918990090 |
| MDL Number | MFCD00017545 |
| SMILES | COc1c(Cl)cc(Cl)cc1C(=O)O |
| InChI | InChI=1S/C8H6Cl2O3/c1-13-7-5(8(11)12)2-4(9)3-6(7)10/h2-3H,1H3,(H,11,12) |
| InChI Key | AUVSCSCAPKFMEK-UHFFFAOYSA-N |
| MSDS | msds/86092_1_22775_37_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Ethyl4-acetyl-5-oxohexanoate | 2832-10-2 | 2A-9086085 |
| 4-Ethyl-3-nitrobenzoicacid | 103440-95-5 | 2A-9086086 |
| 3,4,5-Trimethylbenzoicacid | 1076-88-6 | 2A-9086087 |
| 3-Propylidenephthalide | 17369-59-4 | 2A-9086088 |
| 3-(2-Nitrobenzylidenamino)-2-oxazolidinone | 19687-73-1 | 2A-9086089 |
| Aminochrysene | 2642-98-0 | 2A-9086095 |
| Glycyl-DL-Threonine | 27174-15-8 | 2A-9086098 |
| 2-Amino-3-formylbenzoicacid | 27867-47-6 | 2A-9086100 |
| 8,8'-Diapocarotenedioicacid | 27876-94-4 | 2A-9086101 |
| AC-Trp-Ome | 2824-57-9 | 2A-9086102 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA