CAS Number35756-54-8
SynonymsMalonsaeure-monophenylester; Propanedioic acid,1-phenyl ester; Monophenyl malonate; malonic acid monophenyl ester; malonic acid half phenylester; phenyl malonic half ester; Propanedioic acid,monophenyl ester; 3-oxo-3-phenoxy-propionic acid
Molecular FormulaC9H8O4
Molecular Weight180.15700
Boiling Point352.9ºC at 760mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 35756-54-8 |
| Catalog No. | 2A-9086053 |
| Chinese Name | 3-羰基-3-苯氧基丙酸 |
| Synonyms | Malonsaeure-monophenylester; Propanedioic acid,1-phenyl ester; Monophenyl malonate; malonic acid monophenyl ester; malonic acid half phenylester; phenyl malonic half ester; Propanedioic acid,monophenyl ester; 3-oxo-3-phenoxy-propionic acid |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.15700 |
| Boiling Point | 352.9ºC at 760mmHg |
| Storage Condition | room temperature |
| HTC | 2918990090 |
| SMILES | O=C(O)CC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C9H8O4/c10-8(11)6-9(12)13-7-4-2-1-3-5-7/h1-5H,6H2,(H,10,11)/p-1 |
| InChI Key | FQCRIFDLUQGBHF-UHFFFAOYSA-N |
| MSDS | msds/86053_1_35756_54_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-Methoxypropane-1-sulfonicAcid | 51980-59-7 | 2A-9086041 |
| methyl3-hydroxyisonicotinate | 10128-72-0 | 2A-9086042 |
| Diethyl2,2-diallylmalonate | 3195-24-2 | 2A-9086049 |
| Diethyl2-(3-chloropropyl)-2-ethylmalonate | 32821-60-6 | 2A-9086051 |
| 3-Hydroxy-2-naphthoic-o-toluididechloroacetate | 35245-26-2 | 2A-9086052 |
| Mono-benzylmalonate | 40204-26-0 | 2A-9086054 |
| Dimethyl2-(hydroxyimino)malonate | 42937-74-6 | 2A-9086055 |
| Benzylethylmalonate | 42998-51-6 | 2A-9086056 |
| Diethylacetoxymalonate | 5468-23-5 | 2A-9086058 |
| p-Cresolisovalerate | 55066-56-3 | 2A-9086059 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS