
CAS Number35245-26-2
SynonymsAcetic acid, 2-chloro-, 3-[[(2-methylphenyl)amino]carbonyl]-2-naphthalenyl ester; 3-Hydroxy-2-naphthoic-o-toluidide chloroacetate; [3-[(2-methylphenyl)carbamoyl]naphthalen-2-yl] 2-chloroacetate; MFCD00042714; 3-[(2-Methylphenyl)carbamoyl]-2-naphthyl chloroacetate; EINECS 252-463-5
Molecular FormulaC20H16ClNO3
Molecular Weight353.80
Purity≥98 (TLC)%
Density1.3±0.1 g/cm3
Boiling Point460.3±35.0 °C at 760 mmHg
Melting Point163 - 171 °C
Appearancepowder
EINECS252-463-5
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 35245-26-2 |
| Catalog No. | 2A-9086052 |
| Chinese Name | 萘酚乙酸酯 |
| Synonyms | Acetic acid, 2-chloro-, 3-[[(2-methylphenyl)amino]carbonyl]-2-naphthalenyl ester; 3-Hydroxy-2-naphthoic-o-toluidide chloroacetate; [3-[(2-methylphenyl)carbamoyl]naphthalen-2-yl] 2-chloroacetate; MFCD00042714; 3-[(2-Methylphenyl)carbamoyl]-2-naphthyl chloroacetate; EINECS 252-463-5 |
| Molecular Formula | C20H16ClNO3 |
| Molecular Weight | 353.80 |
| Purity | ≥98 (TLC) |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 460.3±35.0 °C at 760 mmHg |
| Melting Point | 163 - 171 °C |
| Appearance | powder |
| Storage Condition | Sealed and stored at -18 ºC |
| EINECS | 252-463-5 |
| HTC | 2924299090 |
| PubChem ID | 24897441 |
| MDL Number | MFCD00042714 |
| SMILES | Cc1ccccc1NC(=O)c2cc3ccccc3cc2OC(=O)CCl |
| InChI | 1S/C20H16ClNO3/c1-13-6-2-5-9-17(13)22-20(24)16-10-14-7-3-4-8-15(14)11-18(16)25-19(23)12-21/h2-11H,12H2,1H3,(H,22,24) |
| InChI Key | FMVKYSCWHDVMGO-UHFFFAOYSA-N |
| NACRES Code | NA.83 |
| UNSPSC | 12352204 |
| MSDS | msds/86052_1_35245_26_2.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-(6-aminopyridin-3-yl)ethanone | 19828-20-7 | 2A-9086039 |
| 3-Methoxypropane-1-sulfonicAcid | 51980-59-7 | 2A-9086041 |
| methyl3-hydroxyisonicotinate | 10128-72-0 | 2A-9086042 |
| Diethyl2,2-diallylmalonate | 3195-24-2 | 2A-9086049 |
| Diethyl2-(3-chloropropyl)-2-ethylmalonate | 32821-60-6 | 2A-9086051 |
| Monophenylmalonate | 35756-54-8 | 2A-9086053 |
| Mono-benzylmalonate | 40204-26-0 | 2A-9086054 |
| Dimethyl2-(hydroxyimino)malonate | 42937-74-6 | 2A-9086055 |
| Benzylethylmalonate | 42998-51-6 | 2A-9086056 |
| Diethylacetoxymalonate | 5468-23-5 | 2A-9086058 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA