
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 58327-60-9 |
| Catalog No. | 2A-9085703 |
| Chinese Name | 8-羟基-7-丙基喹啉 |
| Synonyms | 7-Propylquinolin-8-ol; 7-Propyl-8-quinolinol |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 338.0±22.0 °C at 760 mmHg |
| Melting Point | 0ºC |
| Appearance | Liquid;Light yellow to Brown clear liquid |
| Storage Condition | Store in a sealed container in a cool, dry place a |
| HTC | 2933499090 |
| MDL Number | MFCD00059755 |
| SMILES | n1c2c(ccc1)ccc(c2O)CCC |
| InChI | InChI=1S/C6HF3N2O4/c7-2-1-3(8)6(11(14)15)4(9)5(2)10(12)13/h1H |
| InChI Key | OKPSVYHYNXVYED-UHFFFAOYSA-N |
| NACRES Code | NA.21 |
| UNSPSC | 12352200 |
| MSDS | msds/85703_1_58327_60_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 4-Chloro-2,8-Dimethylquinoline | 32314-39-9 | 2A-9085693 |
| 2-Butyl-5-Ethylthiophene | 54411-06-2 | 2A-9085695 |
| Quinolineiso-Amyliodide | 54899-89-7 | 2A-9085697 |
| 3-(4-chlorophenyl)-2,5-furandione | 3152-15-6 | 2A-9085700 |
| Thiophene-2,5-DicarboxylicAcidDisodiumSalt | 57665-09-5 | 2A-9085701 |
| 3-(nitromethyl)-2-benzofuran-1(3H)-one | 3598-68-3 | 2A-9085705 |
| 5-(3-Thienyl)Tthiophene-2-CarboxylicAcid | 60141-31-3 | 2A-9085706 |
| 5-(Methylsulfonyl)thiophene-2-carboxylicacid | 60166-86-1 | 2A-9085711 |
| 4-Methylthiophene-2-carboxaldehyde | 6030-36-0 | 2A-9085716 |
| 2-(2-Chloro-Acetylamino)-4,5-Dimethyl-Thiophene-3-CarboxylicAcidEthylEster | 60442-34-4 | 2A-9085719 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA