
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 54899-89-7 |
| Catalog No. | 2A-9085697 |
| Chinese Name | 异戊基喹啉碘盐 |
| Synonyms | 1-Isopentyl-chinolinium,Jodid; Quinoline Isoamyl Iodide; 1-isopentyl-quinolinium,iodide |
| Molecular Formula | C14H18IN |
| Molecular Weight | 327.20400 |
| Melting Point | 184ºC |
| Appearance | Solid;Light yellow to Brown powder to crystal |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2933499090 |
| SMILES | CC(C)CC[n+]1cccc2ccccc21.[I-] |
| InChI Key | JAHQMMYIQANKBZ-UHFFFAOYSA-M |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| QuinolineHydrochloride | 530-64-3 | 2A-9085684 |
| Ethyl6-Fluoro-4-Hydroxy-3-Quinolinecarboxylate | 318-35-4 | 2A-9085686 |
| N'-Hydroxy-2-thiophenecarboximidamide | 53370-51-7 | 2A-9085687 |
| 4-Chloro-2,8-Dimethylquinoline | 32314-39-9 | 2A-9085693 |
| 2-Butyl-5-Ethylthiophene | 54411-06-2 | 2A-9085695 |
| 3-(4-chlorophenyl)-2,5-furandione | 3152-15-6 | 2A-9085700 |
| Thiophene-2,5-DicarboxylicAcidDisodiumSalt | 57665-09-5 | 2A-9085701 |
| 7-N-Propyl-8-Hydroxyquinoline | 58327-60-9 | 2A-9085703 |
| 3-(nitromethyl)-2-benzofuran-1(3H)-one | 3598-68-3 | 2A-9085705 |
| 5-(3-Thienyl)Tthiophene-2-CarboxylicAcid | 60141-31-3 | 2A-9085706 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA