
CAS Number42712-64-1
SynonymsMFCD00052386; 2-Aminoquinolin-4-ol; 2-AMINO-4-HYDROXYQUINOLINE HYDRATE; 2-Amino-4-hydroxyquinoline; 2-Aminoquinolin-4(1H)-one; 2-Amino-4(1H)-quinolinone
Molecular FormulaC9H8N2O
Molecular Weight160.177
Density1.3±0.1 g/cm3
Boiling Point294.1±40.0 °C at 760 mmHg
Melting Point>300 °C(lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 42712-64-1 |
| Catalog No. | 2A-9085651 |
| Chinese Name | 2-氨基-4-羟基喹啉水合物 |
| Synonyms | MFCD00052386; 2-Aminoquinolin-4-ol; 2-AMINO-4-HYDROXYQUINOLINE HYDRATE; 2-Amino-4-hydroxyquinoline; 2-Aminoquinolin-4(1H)-one; 2-Amino-4(1H)-quinolinone |
| Molecular Formula | C9H8N2O |
| Molecular Weight | 160.177 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 294.1±40.0 °C at 760 mmHg |
| Melting Point | >300 °C(lit.) |
| Storage Condition | Sealed, cool and dry storage |
| HTC | 2933499090 |
| MDL Number | MFCD00052386 |
| SMILES | Nc1cc(=O)c2ccccc2[nH]1 |
| InChI | InChI=1S/C9H8N2O/c10-9-5-8(12)6-3-1-2-4-7(6)11-9/h1-5H,(H3,10,11,12) |
| InChI Key | LWGUCIXHBVVATR-UHFFFAOYSA-N |
| MSDS | msds/85651_1_42712_64_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| Thiophene-3-thioamide | 24044-76-6 | 2A-9085645 |
| 3,4,5-Trichlorothiophene-2-carbonylchloride | 24422-15-9 | 2A-9085646 |
| 4,5-Dimethylthiophene-2-carboxylicacid | 40808-24-0 | 2A-9085647 |
| 5-(Methylthio)thiophene-2-carbaldehyde | 24445-35-0 | 2A-9085649 |
| 2-(4-Methoxyphenyl)thiophene | 42545-43-7 | 2A-9085650 |
| Thiophene-2-CarboxylicAcidAnhydride | 25569-97-5 | 2A-9085653 |
| Ethyl2-amino-4-(2-furyl)thiophene-3-carboxylate | 256506-99-7 | 2A-9085657 |
| 1-Benzothiophene-3-CarboximidamidineHydrochloride | 465515-36-0 | 2A-9085660 |
| 2-Quinolinethiol | 2637-37-8 | 2A-9085661 |
| 2,5-Dmethylthiophene-3-CarboxylicAcid | 26421-32-9 | 2A-9085664 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA