
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 40808-24-0 |
| Catalog No. | 2A-9085647 |
| Chinese Name | 4,5-二甲基噻吩-2-羰酸 |
| Synonyms | MFCD00512748; 4,5-dimethylthiophene-2-carboxylic acid |
| Molecular Formula | C7H8O2S1 |
| Molecular Weight | 156.21 |
| Density | 1.259 g/cm3 |
| Boiling Point | 290.6ºC at 760 mmHg |
| Melting Point | 206-211°C |
| Appearance | White to light yellow crystal powder |
| Storage Condition | Sealed, cool and dry storage |
| HTC | 2934999090 |
| MDL Number | MFCD00512748 |
| SMILES | Cc1cc(C(=O)O)sc1C |
| InChI | InChI=1S/C7H8O2S/c1-4-3-6(7(8)9)10-5(4)2/h3H,1-2H3,(H,8,9)/p-1 |
| InChI Key | RZCDKLUMNAKVFB-UHFFFAOYSA-N |
| MSDS | msds/85647_1_40808_24_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 5-(4-Methoxyphenyl)Thiophene-2-Carbaldehyde | 38401-67-1 | 2A-9085640 |
| 2-Cinnamoylthiophene | 3988-77-0 | 2A-9085643 |
| 7-Chloro-4-Hydrazinoquinoline | 23834-14-2 | 2A-9085644 |
| Thiophene-3-thioamide | 24044-76-6 | 2A-9085645 |
| 3,4,5-Trichlorothiophene-2-carbonylchloride | 24422-15-9 | 2A-9085646 |
| 5-(Methylthio)thiophene-2-carbaldehyde | 24445-35-0 | 2A-9085649 |
| 2-(4-Methoxyphenyl)thiophene | 42545-43-7 | 2A-9085650 |
| 2-Amino-4-HydroxyquinolineHydrate | 42712-64-1 | 2A-9085651 |
| Thiophene-2-CarboxylicAcidAnhydride | 25569-97-5 | 2A-9085653 |
| Ethyl2-amino-4-(2-furyl)thiophene-3-carboxylate | 256506-99-7 | 2A-9085657 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA