
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 582-83-2 |
| Catalog No. | 2A-9085444 |
| Chinese Name | 4-氟苯丁酮 |
| Synonyms | Butyrophenone,4'-fluoro; 4'-Fluorobutyrophenone; MFCD00017967; p-fluorobutyrophenone; 4-Fluorbutyrophenon; EINECS 209-492-3 |
| Molecular Formula | C10H11FO |
| Molecular Weight | 166.2 |
| Density | 1.05g/cm3 |
| Boiling Point | 102 °C |
| Melting Point | 38 °C |
| Storage Condition | 7 |
| HTC | 2914700090 |
| MDL Number | C10H11FO |
| SMILES | CCCC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C10H11FO/c1-2-3-10(12)8-4-6-9(11)7-5-8/h4-7H,2-3H2,1H3 |
| InChI Key | QHDXPJMOWRLLRV-UHFFFAOYSA-N |
| MSDS | msds/85444_1_582_83_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 3-(2-Methoxybenzyloxy)propylchloride | 188875-36-7 | 2A-9085436 |
| 2-Formyl-5-nitroanisole | 136507-15-8 | 2A-9085437 |
| 4-Chlorobenzoylchloride | 122-01-1 | 2A-9085438 |
| 2,2,3,3-Tetrafluoropropyl2-fluoroacrylate | 96250-37-2 | 2A-9085439 |
| 3,4-Dimethoxybromobenzene | 2589-78-1 | 2A-9085440 |
| Thiane | 1413-51-0 | 2A-9085445 |
| 4'-Acetoxy-3',5'-dimethoxyacetophenone | 28294-47-5 | 2A-9085447 |
| 1-(2,6-Difluorophenyl)Butan-1-One | 95727-77-8 | 2A-9085450 |
| 5-Chloro-pentanal | 20074-80-0 | 2A-9085451 |
| 8-Bromoinsine | 55627-73-1 | 2A-9085463 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA