
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 136507-15-8 |
| Catalog No. | 2A-9085437 |
| Chinese Name | 2-甲氧基-4-硝基苯甲醛 |
| Synonyms | 2-Methoxy-4-nitrobenzaldehyde; MFCD02683052 |
| Molecular Formula | O2NC6H3(OCH3)CHO |
| Molecular Weight | 181.15 |
| Purity | 97 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 354.7±27.0 °C at 760 mmHg |
| Melting Point | 120-124 °C |
| Appearance | solid |
| Storage Condition | room temperature |
| HTC | 2913000090 |
| PubChem ID | 24884343 |
| MDL Number | MFCD02683052 |
| SMILES | COc1cc(ccc1C=O)[N+]([O-])=O |
| InChI | 1S/C8H7NO4/c1-13-8-4-7(9(11)12)3-2-6(8)5-10/h2-5H,1H3 |
| InChI Key | LEBUUZXTHMCZQZ-UHFFFAOYSA-N |
| NACRES Code | NA.22 |
| UNSPSC | 12352100 |
| MSDS | msds/85437_1_136507_15_8.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-Fluoro-2-methyl-1-(methylsulfonyl)benzene | 828270-62-8 | 2A-9085425 |
| 2-Phenoxybiphenyl | 6738-04-1 | 2A-9085429 |
| 4-t-Butoxystyrene | 95418-58-9 | 2A-9085432 |
| 2-Methoxybenzyltosylate | 900797-81-1 | 2A-9085435 |
| 3-(2-Methoxybenzyloxy)propylchloride | 188875-36-7 | 2A-9085436 |
| 4-Chlorobenzoylchloride | 122-01-1 | 2A-9085438 |
| 2,2,3,3-Tetrafluoropropyl2-fluoroacrylate | 96250-37-2 | 2A-9085439 |
| 3,4-Dimethoxybromobenzene | 2589-78-1 | 2A-9085440 |
| 1-(4-Fluoro-Phenyl)-Butan-1-One | 582-83-2 | 2A-9085444 |
| Thiane | 1413-51-0 | 2A-9085445 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA