
CAS Number5624-27-1
SynonymsMFCD00070137; Glutamic phenylthiohydantoin; 3-(5-Oxo-1-phenyl-2-thioxo-imidazolidin-4-yl)-propionsaeure; EINECS 227-056-0; Pth-glutamic acid; 5-Oxo-1-phenyl-2-thioxo-4-imidazolidinepropionic acid; Glutaminsaeure-PTH; 4-IMIDAZOLIDINEPROPIONIC ACID,5-OXO-1-PHENYL-2-THIOXO; 5-Oxo-1-phenyl-2-thioxoimidazolidine-4-propionic acid; 3-(5-oxo-1-phenyl-2-thioxo-imidazolidin-4-yl)-propionic acid; Glutamic acid phenylthiohydantoin; D,L-glutamic acid N-phenylthiohydantoin; 4-Imidazolidinepropanoic acid,5-oxo-1-phenyl-2-thioxo
Molecular FormulaC12H12N2O3S
Molecular Weight264.30000
Density1.45g/cm3
Boiling Point443ºC at 760mmHg
Melting Point168ºC
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5624-27-1 |
| Catalog No. | 2A-9085379 |
| Chinese Name | 苯基硫代乙内酰脲-谷氨酸 |
| Synonyms | MFCD00070137; Glutamic phenylthiohydantoin; 3-(5-Oxo-1-phenyl-2-thioxo-imidazolidin-4-yl)-propionsaeure; EINECS 227-056-0; Pth-glutamic acid; 5-Oxo-1-phenyl-2-thioxo-4-imidazolidinepropionic acid; Glutaminsaeure-PTH; 4-IMIDAZOLIDINEPROPIONIC ACID,5-OXO-1-PHENYL-2-THIOXO; 5-Oxo-1-phenyl-2-thioxoimidazolidine-4-propionic acid; 3-(5-oxo-1-phenyl-2-thioxo-imidazolidin-4-yl)-propionic acid; Glutamic acid phenylthiohydantoin; D,L-glutamic acid N-phenylthiohydantoin; 4-Imidazolidinepropanoic acid,5-oxo-1-phenyl-2-thioxo |
| Molecular Formula | C12H12N2O3S |
| Molecular Weight | 264.30000 |
| Density | 1.45g/cm3 |
| Boiling Point | 443ºC at 760mmHg |
| Melting Point | 168ºC |
| Storage Condition | -20℃ Avoid light, keep in a cool and dry place, se |
| HTC | 2933990090 |
| SMILES | O=C(O)CCC1NC(=S)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C12H12N2O3S/c15-10(16)7-6-9-11(17)14(12(18)13-9)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,13,18)(H,15,16) |
| InChI Key | ULKNJYDXLYMGFB-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 95.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| PTH-Cysteicacidsodiumsalt | 108321-85-3 | 2A-9085374 |
| 4-Allyloxyacetanilide | 6622-73-7 | 2A-9085375 |
| PTH-Asparagine | 5624-08-8 | 2A-9085376 |
| 4-Nitrophenylaceticacidsodiumsalt | 7063-24-3 | 2A-9085377 |
| p-Benzanisidide | 7472-54-0 | 2A-9085378 |
| 3-Iodo-4methoxyacetophenone | 79324-77-9 | 2A-9085380 |
| PTH-Glutamine | 10567-86-9 | 2A-9085381 |
| PTH-Delta-threonine | 5800-50-0 | 2A-9085382 |
| 4-N-Heptyloxyphenylacetylene | 79887-18-6 | 2A-9085384 |
| 2-Amino-6,7-dimethyl-4-hydroxypteridine | 611-55-2 | 2A-9085386 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA