
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 7472-54-0 |
| Catalog No. | 2A-9085378 |
| Chinese Name | 对苯茴香胺 |
| Synonyms | N-(4-methoxyphenyl)benzamide |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.25900 |
| Density | 1.181 g/cm3 |
| Boiling Point | 290.2ºC at 760 mmHg |
| Melting Point | 155ºC |
| Appearance | Solid;White to Light yellow to Dark green powder to crystal |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2924299090 |
| SMILES | COc1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C14H13NO2/c1-17-13-9-7-12(8-10-13)15-14(16)11-5-3-2-4-6-11/h2-10H,1H3,(H,15,16) |
| InChI Key | KEEBHMMBUBEEOV-UHFFFAOYSA-N |
| MSDS | msds/85378_1_7472_54_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| PTH-L-Proline | 29635-99-2 | 2A-9085372 |
| PTH-Cysteicacidsodiumsalt | 108321-85-3 | 2A-9085374 |
| 4-Allyloxyacetanilide | 6622-73-7 | 2A-9085375 |
| PTH-Asparagine | 5624-08-8 | 2A-9085376 |
| 4-Nitrophenylaceticacidsodiumsalt | 7063-24-3 | 2A-9085377 |
| PTH-Glutamicacid | 5624-27-1 | 2A-9085379 |
| 3-Iodo-4methoxyacetophenone | 79324-77-9 | 2A-9085380 |
| PTH-Glutamine | 10567-86-9 | 2A-9085381 |
| PTH-Delta-threonine | 5800-50-0 | 2A-9085382 |
| 4-N-Heptyloxyphenylacetylene | 79887-18-6 | 2A-9085384 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA