
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 207919-09-3 |
| Catalog No. | 2A-9085282 |
| Chinese Name | 2,3,4-三氟苯甲酰胺 |
| Synonyms | 2,3,4-Trifluorobenzamide; MFCD00061265; Benzamide,2,3,4-trifluoro; 2,3,4,5,6-PENTAFLUOROPHENYL 1-NAPHTHALENESULFONATE |
| Molecular Formula | C7H4O1N1F3 |
| Molecular Weight | 175.11 |
| Density | 1.45g/cm3 |
| Boiling Point | 166ºC at 760 mmHg |
| Melting Point | 127-129°C |
| Storage Condition | Storage method: airtight, cool, ventilated and dry |
| HTC | 2924299090 |
| MDL Number | MFCD00061265 |
| SMILES | NC(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C7H4F3NO/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2H,(H2,11,12) |
| InChI Key | XGOGYOBKQVLGAY-UHFFFAOYSA-N |
| MSDS | msds/85282_1_207919_09_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-Amino-N-cyclohexylbenzamide | 56814-11-0 | 2A-9085263 |
| 2-Amino-N-tert-butylbenzamide | 1203-89-0 | 2A-9085266 |
| 2-Amino-N-methylbenzamide | 4141-08-6 | 2A-9085268 |
| Haematoporphyrin | 14459-29-1 | 2A-9085278 |
| 2,4,6-Trifluorobenzamide | 82019-50-9 | 2A-9085281 |
| Amino-(3-chloro-phenyl)aceticacid | 7292-71-9 | 2A-9085283 |
| TranylcypromineHemisulfate | 13492-01-8 | 2A-9085285 |
| N-(2-Aminoethyl)-4-chlorobenzamideHydrochloride | 94319-79-6 | 2A-9085287 |
| 3,4,5-Trifluorobenzamide | 78324-75-1 | 2A-9085289 |
| 2-Chloro-3,4-dimethoxybenzamide | 175136-02-4 | 2A-9085290 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA