
CAS Number55836-69-6
SynonymsMFCD00007988; 3-Aethoxy-benzoesaeure-amid; 3-ethoxy-benzoic acid amide; EINECS 259-846-6; 3-Ethoxy-benzamide; Benzamide,3-ethoxy; 3-Aethoxy-benzamid; m-Ethoxybenzamide
Molecular FormulaC15H14ClNO2
Molecular Weight275.737
Density1.111g/cm3
Boiling Point293.4ºC at 760mmHg
Melting Point138-140 °C(lit.)
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 55836-69-6 |
| Catalog No. | 2A-9085114 |
| Chinese Name | 3-乙氧基苯甲酰胺 |
| Synonyms | MFCD00007988; 3-Aethoxy-benzoesaeure-amid; 3-ethoxy-benzoic acid amide; EINECS 259-846-6; 3-Ethoxy-benzamide; Benzamide,3-ethoxy; 3-Aethoxy-benzamid; m-Ethoxybenzamide |
| Molecular Formula | C15H14ClNO2 |
| Molecular Weight | 275.737 |
| Density | 1.111g/cm3 |
| Boiling Point | 293.4ºC at 760mmHg |
| Melting Point | 138-140 °C(lit.) |
| Storage Condition | Place in a tight container and store in a cool, dr |
| HTC | 2924299090 |
| MDL Number | MFCD00816426 |
| SMILES | CCOc1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C9H11NO2/c1-2-12-8-5-3-4-7(6-8)9(10)11/h3-6H,2H2,1H3,(H2,10,11) |
| InChI Key | NDOYNKFWOCOOIR-UHFFFAOYSA-N |
| MSDS | msds/85114_1_55836_69_6.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4'-Fluorobiphenyl-3-ylamine | 10540-45-1 | 2A-9085105 |
| 3,5-dichlorobenzene-1-carboximidamidehydrochloride | 22978-61-6 | 2A-9085108 |
| 3-Formylbenzamidinehydrochloride | 57081-01-3 | 2A-9085109 |
| Chloro(bis-pentafluoroethyl)phosphine | 35449-89-9 | 2A-9085110 |
| 3-Methoxybenzamide | 5813-86-5 | 2A-9085113 |
| 4-Amidinobenzamidehydrochloride | 59855-11-7 | 2A-9085115 |
| 3,4,5-Trihydroxybenzamidehydrate | 618-73-5 | 2A-9085117 |
| 2-Chloro-4-nitrobenzamide | 3011-89-0 | 2A-9085118 |
| 2-Methoxybenzamide | 2439-77-2 | 2A-9085120 |
| 2,6-Dihydroxybenzamide | 3147-50-0 | 2A-9085121 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA