
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 774-48-1 |
| Catalog No. | 2A-9084842 |
| Chinese Name | 苯甲醛二乙缩醛 |
| Synonyms | benzaldehyde diethyl acetal; EINECS 212-265-1; MFCD00038525 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.249 |
| Density | 1,57 g/cm3 |
| Boiling Point | 222 °C |
| Appearance | Liquid;Colorless to Almost colorless clear liquid |
| Storage Condition | Store under inert gas; avoid moisture (decompositi |
| HTC | 2909309090 |
| MDL Number | MFCD00038525 |
| SMILES | CCOC(OCC)c1ccccc1 |
| InChI | InChI=1S/C11H16O2/c1-3-12-11(13-4-2)10-8-6-5-7-9-10/h5-9,11H,3-4H2,1-2H3 |
| InChI Key | MAQMEXSLUSZDQM-UHFFFAOYSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3-Bromobenzaldoxime | 51873-95-1 | 2A-9084804 |
| 3,4-Dichlorobenzaldoxime | 5331-92-0 | 2A-9084806 |
| 2,3-Dimethoxybenzaldoxime | 5470-95-1 | 2A-9084808 |
| 4-Bromobenzaldehydepropylideneacetal | 61568-51-2 | 2A-9084812 |
| 2,3,5,6-Tetrafluoro-4-(trifluoromethyl)phenyl-hydrazine | 1868-85-5 | 2A-9084833 |
| 4-N-Hexyl-benzaldehydediethylacetal | 89511-01-3 | 2A-9084845 |
| 4-Propylbenzaldehydediethylacetal | 89557-35-7 | 2A-9084847 |
| 4-(2-Fluorophenyl)-3-thiosemicarbazide | 38985-72-7 | 2A-9084863 |
| 4-(2-Methoxyphenyl)-3-thiosemicarbazide | 40207-02-1 | 2A-9084865 |
| 4-(2-Methylphenyl)-3-thiosemicarbazide | 614-10-8 | 2A-9084867 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA