
CAS Number1868-85-5
Synonyms2,3,5,6-Tetrafluoro-4-hydrazinobenzotrifluoride; 4-hydrazoheptafluorotoluene; (Perfluoro-p-tolyl)hydrazine; (α,α,α,2,3,5,6-Heptafluoro-p-tolyl)hydrazine; MFCD00012368; 2,3,4,5-TETRAFLUORO-D-PHENYLALANINE; (alpha,alpha,alpha,2,3,5,6-Heptafluoro-p-tolyl)hydrazine
Molecular FormulaC6H3BrF4N2
Molecular Weight259.002
Density1.694 g/cm3
Boiling Point142.9ºC at 760 mmHg
Melting Point81-83 °C(lit.)
AppearanceWhite-yellow-red crystal-powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1868-85-5 |
| Catalog No. | 2A-9084833 |
| Chinese Name | (α,α,α,2,3,5,6-七氟邻甲苯基)肼 |
| Synonyms | 2,3,5,6-Tetrafluoro-4-hydrazinobenzotrifluoride; 4-hydrazoheptafluorotoluene; (Perfluoro-p-tolyl)hydrazine; (α,α,α,2,3,5,6-Heptafluoro-p-tolyl)hydrazine; MFCD00012368; 2,3,4,5-TETRAFLUORO-D-PHENYLALANINE; (alpha,alpha,alpha,2,3,5,6-Heptafluoro-p-tolyl)hydrazine |
| Molecular Formula | C6H3BrF4N2 |
| Molecular Weight | 259.002 |
| Density | 1.694 g/cm3 |
| Boiling Point | 142.9ºC at 760 mmHg |
| Melting Point | 81-83 °C(lit.) |
| Appearance | White-yellow-red crystal-powder |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2928000090 |
| MDL Number | MFCD01075256 |
| SMILES | NNc1c(F)c(F)c(C(F)(F)F)c(F)c1F |
| InChI | InChI=1S/C7H3F7N2/c8-2-1(7(12,13)14)3(9)5(11)6(16-15)4(2)10/h16H,15H2 |
| InChI Key | TVSDZBUZBHRNBV-UHFFFAOYSA-N |
| MSDS | msds/84833_1_1868_85_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| [(3-Methoxyphenyl)methylene]hydrazone-3-methoxybenzaldehyde | 40252-74-2 | 2A-9084801 |
| 3-Bromobenzaldoxime | 51873-95-1 | 2A-9084804 |
| 3,4-Dichlorobenzaldoxime | 5331-92-0 | 2A-9084806 |
| 2,3-Dimethoxybenzaldoxime | 5470-95-1 | 2A-9084808 |
| 4-Bromobenzaldehydepropylideneacetal | 61568-51-2 | 2A-9084812 |
| Benzaldehydediethylacetal | 774-48-1 | 2A-9084842 |
| 4-N-Hexyl-benzaldehydediethylacetal | 89511-01-3 | 2A-9084845 |
| 4-Propylbenzaldehydediethylacetal | 89557-35-7 | 2A-9084847 |
| 4-(2-Fluorophenyl)-3-thiosemicarbazide | 38985-72-7 | 2A-9084863 |
| 4-(2-Methoxyphenyl)-3-thiosemicarbazide | 40207-02-1 | 2A-9084865 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA