
CAS Number34158-72-0
Synonyms2-Bromobenzaldehyde oxime; 2-Bromobenzaldoxime; o-bromobenzaldoxime; (E)-2-bromobenzaldehyde oxime; 2-Bromobenzaldehydeoxime; 2-bromo-N-hydroxybenzimidoyl; 2-Brom-benzaldehyd-oxim; MFCD00082734
Molecular FormulaC7H6BrNO
Molecular Weight200.03300
Density1.52 g/cm3
Boiling Point265.6ºC at 760 mmHg
Melting Point102-104°C
AppearanceLight yellow liquid or solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 34158-72-0 |
| Catalog No. | 2A-9084794 |
| Chinese Name | 2-溴苯甲醛肟 |
| Synonyms | 2-Bromobenzaldehyde oxime; 2-Bromobenzaldoxime; o-bromobenzaldoxime; (E)-2-bromobenzaldehyde oxime; 2-Bromobenzaldehydeoxime; 2-bromo-N-hydroxybenzimidoyl; 2-Brom-benzaldehyd-oxim; MFCD00082734 |
| Molecular Formula | C7H6BrNO |
| Molecular Weight | 200.03300 |
| Density | 1.52 g/cm3 |
| Boiling Point | 265.6ºC at 760 mmHg |
| Melting Point | 102-104°C |
| Appearance | Light yellow liquid or solid |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2928000090 |
| SMILES | ON=Cc1ccccc1Br |
| InChI | InChI=1S/C7H6BrNO/c8-7-4-2-1-3-6(7)5-9-10/h1-5,10H/b9-5- |
| InChI Key | PSIRFUPZHPEKAE-UITAMQMPSA-N |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified 2-Bromobenzaldehyde oxime Modification number: 5 |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-Pentylbenzaldehydeoxime | 175136-45-5 | 2A-9084788 |
| 4-(2-Phenyleth-1-ynyl)benzaldehydeoxime | 175203-56-2 | 2A-9084789 |
| 3,4-Methylenedioxybenzaldehydeoxime | 2089-36-3 | 2A-9084790 |
| 4-Anisaldehydeazine | 2299-73-2 | 2A-9084791 |
| 2-Methoxybenzaldehydeoxime | 29577-53-5 | 2A-9084793 |
| 3,4,5-Trimethoxybenzaldoxime | 39201-89-3 | 2A-9084798 |
| 4-Biphenylaldehydeoxime | 40143-27-9 | 2A-9084799 |
| [(3-Methoxyphenyl)methylene]hydrazone-3-methoxybenzaldehyde | 40252-74-2 | 2A-9084801 |
| 3-Bromobenzaldoxime | 51873-95-1 | 2A-9084804 |
| 3,4-Dichlorobenzaldoxime | 5331-92-0 | 2A-9084806 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA