
CAS Number2089-36-3
Synonyms1,3-benzodioxole-5-carboxaldoxime; 3,4-methylenedioxybenzaldoxime; 3,4-METHYLENEDIOXYBENZALDEHYDE OXIME; MFCD00016905; 3,4-methylenebenzaldehyde oxime; 1,3-benzodioxole-5-carbaldehyde oxime; 1,3-benzodioxole-5-carboxaldehyde,oxime; PIPERONAL OXIME
Molecular FormulaC8H7NO3
Molecular Weight165.15
Density1.38g/cm3
Boiling Point279.8ºC at 760 mmHg
Melting Point114-116°C
Appearancewhite solid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 2089-36-3 |
| Catalog No. | 2A-9084790 |
| Chinese Name | 胡椒醛肟 |
| Synonyms | 1,3-benzodioxole-5-carboxaldoxime; 3,4-methylenedioxybenzaldoxime; 3,4-METHYLENEDIOXYBENZALDEHYDE OXIME; MFCD00016905; 3,4-methylenebenzaldehyde oxime; 1,3-benzodioxole-5-carbaldehyde oxime; 1,3-benzodioxole-5-carboxaldehyde,oxime; PIPERONAL OXIME |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 |
| Density | 1.38g/cm3 |
| Boiling Point | 279.8ºC at 760 mmHg |
| Melting Point | 114-116°C |
| Appearance | white solid |
| Storage Condition | Store in a place to avoid contact with oxidants, s |
| HTC | 2932999099 |
| MDL Number | MFCD00016905 |
| SMILES | ON=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C8H7NO3/c10-9-4-6-1-2-7-8(3-6)12-5-11-7/h1-4,10H,5H2/b9-4+ |
| InChI Key | VDAJDWUTRXNYMU-RUDMXATFSA-N |
| MSDS | msds/84790_1_2089_36_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2,4-Bis(chloromethyl)-1,3,5-trimethylbenzene | 1585-17-7 | 2A-9084756 |
| Benzaldehydetosylhydrazone | 1666-17-7 | 2A-9084786 |
| 2-Methyl-5-nitro-benzaldehydeoxime | 173058-88-3 | 2A-9084787 |
| 4-Pentylbenzaldehydeoxime | 175136-45-5 | 2A-9084788 |
| 4-(2-Phenyleth-1-ynyl)benzaldehydeoxime | 175203-56-2 | 2A-9084789 |
| 4-Anisaldehydeazine | 2299-73-2 | 2A-9084791 |
| 2-Methoxybenzaldehydeoxime | 29577-53-5 | 2A-9084793 |
| 2-Bromobenzaldoxime | 34158-72-0 | 2A-9084794 |
| 3,4,5-Trimethoxybenzaldoxime | 39201-89-3 | 2A-9084798 |
| 4-Biphenylaldehydeoxime | 40143-27-9 | 2A-9084799 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA