
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 83-24-9 |
| Catalog No. | 2A-9084662 |
| Chinese Name | 2,5-二甲基-1-苯基吡咯 |
| Synonyms | EINECS 201-461-2; 2,5-dimethyl-1-phenylpyrrole; MFCD00022464 |
| Molecular Formula | C12H13N1 |
| Molecular Weight | 171.24 |
| Density | 0.96 g/cm3 |
| Boiling Point | 155-160°C 15mm |
| Melting Point | 51-52 °C |
| Appearance | Solid;Light yellow to Brown to Dark green powder to crystal |
| Water Solubility | Soluble in: methanol |
| Storage Condition | Keep Cold |
| HTC | 2933990090 |
| MDL Number | MFCD00022464 |
| SMILES | Cc1ccc(C)n1-c1ccccc1 |
| InChI | InChI=1S/C12H13N/c1-10-8-9-11(2)13(10)12-6-4-3-5-7-12/h3-9H,1-2H3 |
| InChI Key | JNXIFVSGXLGULI-UHFFFAOYSA-N |
| MSDS | msds/84662_1_83_24_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 3-Chloro-5-(3-chlorobenzylsulfonyl)-1,2,4-thiadiazole | 444791-18-8 | 2A-9084654 |
| 3-Chloro-5-(4-chlorobenzylsulfonyl)-1,2,4-thiadiazole | 444791-19-9 | 2A-9084656 |
| 4-Chloro-5-(4-chlorophenyl)thieno[2,3-d]pyrimidine | 331761-46-7 | 2A-9084657 |
| 2,8-Dimethyldibenzothiophene | 1207-15-4 | 2A-9084658 |
| 3,5-Dimethyl-1-phenyl-1H-pyrazole-4-carbaldehyde | 22042-79-1 | 2A-9084661 |
| 2-(5-Methyl-2-phenylthiazole-4-yl)aceticacid | 101736-22-5 | 2A-9084663 |
| 1,2,3,4-Tetrahydro-quinoline-2-carboxylicacidmethylester | 63430-79-5 | 2A-9084664 |
| Methyl-2-isothiocyanatothiophene-3-carboxylate | 126637-07-8 | 2A-9084666 |
| 3-(2-Thiazolyl)propionicacid | 144163-65-5 | 2A-9084667 |
| 6-MethoxyquinolineN-oxide | 6563-13-9 | 2A-9084669 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA