CAS Number22042-79-1
Synonyms3,5-dimethyl-1-phenyl-4-formylpyrazole; 4-formyl-3,5-dimethyl-1-phenylpyrazole; 3,5-Dimethyl-1-phenylpyrazole-4-carboxaldehyde; 3,5-dimethyl1-phenyl-1H-pyrazole-4-carbaldehyde; 3,5-dimethyl-1-phenyl-1H-pyrazole-4-carboxaldehyde; MFCD00051396; 1H-Pyrazole-4-carboxaldehyde,3,5-dimethyl-1-phenyl; 3,5-dimethyl-1-phenyl-1H-4-pyrazolecarbaldehyde; 3,5-Dimethyl-1-phenyl-1H-pyrazole-4-carbaldehyde; EINECS 244-750-9
Molecular FormulaC12H12N2O
Molecular Weight200.242
Density1.11 g/cm3
Boiling Point340ºC at 760 mmHg
Melting Point125-128 °C
AppearanceBeige to light yellow powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 22042-79-1 |
| Catalog No. | 2A-9084661 |
| Chinese Name | 3,5-二甲基-1-苯基-1H-吡唑-4-甲醛 |
| Synonyms | 3,5-dimethyl-1-phenyl-4-formylpyrazole; 4-formyl-3,5-dimethyl-1-phenylpyrazole; 3,5-Dimethyl-1-phenylpyrazole-4-carboxaldehyde; 3,5-dimethyl1-phenyl-1H-pyrazole-4-carbaldehyde; 3,5-dimethyl-1-phenyl-1H-pyrazole-4-carboxaldehyde; MFCD00051396; 1H-Pyrazole-4-carboxaldehyde,3,5-dimethyl-1-phenyl; 3,5-dimethyl-1-phenyl-1H-4-pyrazolecarbaldehyde; 3,5-Dimethyl-1-phenyl-1H-pyrazole-4-carbaldehyde; EINECS 244-750-9 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.242 |
| Density | 1.11 g/cm3 |
| Boiling Point | 340ºC at 760 mmHg |
| Melting Point | 125-128 °C |
| Appearance | Beige to light yellow powder |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2933199090 |
| MDL Number | MFCD00051396 |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C=O |
| InChI | InChI=1S/C12H12N2O/c1-9-12(8-15)10(2)14(13-9)11-6-4-3-5-7-11/h3-8H,1-2H3 |
| InChI Key | VOMRTQQGXWPTJK-UHFFFAOYSA-N |
| MSDS | msds/84661_1_22042_79_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 3-Chloro-5-(2-chlorobenzylsulfonyl)-1,2,4-thiadiazole | 444791-20-2 | 2A-9084653 |
| 3-Chloro-5-(3-chlorobenzylsulfonyl)-1,2,4-thiadiazole | 444791-18-8 | 2A-9084654 |
| 3-Chloro-5-(4-chlorobenzylsulfonyl)-1,2,4-thiadiazole | 444791-19-9 | 2A-9084656 |
| 4-Chloro-5-(4-chlorophenyl)thieno[2,3-d]pyrimidine | 331761-46-7 | 2A-9084657 |
| 2,8-Dimethyldibenzothiophene | 1207-15-4 | 2A-9084658 |
| 2,5-Dimethyl-1-phenylpyrrole | 83-24-9 | 2A-9084662 |
| 2-(5-Methyl-2-phenylthiazole-4-yl)aceticacid | 101736-22-5 | 2A-9084663 |
| 1,2,3,4-Tetrahydro-quinoline-2-carboxylicacidmethylester | 63430-79-5 | 2A-9084664 |
| Methyl-2-isothiocyanatothiophene-3-carboxylate | 126637-07-8 | 2A-9084666 |
| 3-(2-Thiazolyl)propionicacid | 144163-65-5 | 2A-9084667 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS