
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 42508-60-1 |
| Catalog No. | 2A-9084535 |
| Chinese Name | N-氯化乙酮吡啶 |
| Synonyms | 1-(2-Oxopropyl)pyridinium chloride; Pyridinium, 1-(2-oxopropyl)-, chloride (1:1); 1-pyridin-1-ium-1-ylpropan-2-one,chloride; MFCD00031949; 1-Acetonylpyridinium chloride |
| Molecular Formula | C8H10ClNO |
| Molecular Weight | 171.628 |
| Melting Point | 207ºC |
| Storage Condition | Sealed, cool and dry storage |
| HTC | 2933399090 |
| MDL Number | MFCD00031949 |
| SMILES | CC(=O)C[n+]1ccccc1.[Cl-] |
| InChI | InChI=1S/C8H10NO.ClH/c1-8(10)7-9-5-3-2-4-6-9;/h2-6H,7H2,1H3;1H/q+1;/p-1 |
| InChI Key | JHYYWKUENNZTMD-UHFFFAOYSA-M |
| MSDS | msds/84535_1_42508_60_1.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(2-Furyl)benzoicacid | 331943-47-3 | 2A-9084516 |
| 4-N-Amyloxybromobenzene | 30752-18-2 | 2A-9084517 |
| 3-(2-Hydroxypropyl)-5-methyl-2-oxazolidinone | 3375-84-6 | 2A-9084518 |
| 4-N-Amylbenzenesulfonylchloride | 73948-18-2 | 2A-9084519 |
| 5-(3-Methylphenyl)-2-furoicacid | 400744-57-2 | 2A-9084527 |
| 1-(2-Furyl)butan-1-one | 4208-57-5 | 2A-9084537 |
| 1,2-O-Isopropylidene-D-mannitol | 4306-35-8 | 2A-9084539 |
| Phenylthiohydantoin-valine | 4333-20-4 | 2A-9084540 |
| Tetraphenylphosphoniumiodide | 2065-67-0 | 2A-9084541 |
| Dihydrokainicacid | 52497-36-6 | 2A-9084547 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA