
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 41458-65-5 |
| Catalog No. | 2A-9084420 |
| Chinese Name | 6-氨基-2,4-二甲基苯酚 |
| Synonyms | EINECS 255-380-2; 2-Amino-4,6-dimethylphenol; 6-AMINO-2,4-DIMETHYLPHENOL; MFCD00007691; 2-Hydroxy-3,5-dimethylaniline |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.179 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 244.7±28.0 °C at 760 mmHg |
| Melting Point | 130ºC |
| Storage Condition | Sealed, cool and dry storage |
| HTC | 2922299090 |
| SMILES | Cc1cc(C)c(O)c(N)c1 |
| InChI | InChI=1S/C8H11NO/c1-5-3-6(2)8(10)7(9)4-5/h3-4,10H,9H2,1-2H3 |
| InChI Key | GISWNAMJAQRJPC-UHFFFAOYSA-N |
| MSDS | msds/84420_1_41458_65_5.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Agrochemical Intermediates | ||
|---|---|---|
| 2,4-Dimethylphenylurea | 2990-02-5 | 2A-9084299 |
| 2,4-Diaminodiphenylamine | 136-17-4 | 2A-9084326 |
| N-(2,4-Dimethylphenyl)-3-(phosphonooxy)-2-naphthalenecarboxamide | 1596-56-1 | 2A-9084358 |
| 1-Amino-8-naphthol-2,4-disulfonicacidmonosodiumsalt | 52789-62-5 | 2A-9084374 |
| (2,4-Dichlorobenzyl)triphenylphosphoniumChloride | 2492-23-1 | 2A-9084387 |
| 2,4-Dichloro-6-nitroaniline | 2683-43-4 | 2A-9084440 |
| 2,4-Dinitrobenzylbromide | 3013-38-5 | 2A-9084460 |
| 2,4,5-Tribromotoluene | 3278-88-4 | 2A-9084581 |
| 2,4-Dinitrobenzylchloride | 610-57-1 | 2A-9084707 |
| 2,4-DintrobenzenesulfonicAcidSodiumSalt | 885-62-1 | 2A-9084752 |
| Browse all Agrochemical Intermediates products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA