
CAS Number489-78-1
SynonymsMFCD00035712; EINECS 207-700-7; M Acid Hydrate; 5-Amino-1-naphthol-3-sulfonic Acid; 8-Amino-4-hydroxy-2-naphthalenesulfonic Acid Hydrate; 8-amino-4-hydroxynaphthalene-2-sulfonic acid
Molecular FormulaC10H9NO4S
Molecular Weight239.24800
Density0.5879
Boiling Point−6.9 °C(lit.)
Melting Point−140 °C
AppearanceColorless gas.
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 489-78-1 |
| Catalog No. | 2A-9084349 |
| Chinese Name | 5-氨基-1-萘酚-3-磺酸水合物 |
| Synonyms | MFCD00035712; EINECS 207-700-7; M Acid Hydrate; 5-Amino-1-naphthol-3-sulfonic Acid; 8-Amino-4-hydroxy-2-naphthalenesulfonic Acid Hydrate; 8-amino-4-hydroxynaphthalene-2-sulfonic acid |
| Molecular Formula | C10H9NO4S |
| Molecular Weight | 239.24800 |
| Density | 0.5879 |
| Boiling Point | −6.9 °C(lit.) |
| Melting Point | −140 °C |
| Appearance | Colorless gas. |
| Storage Condition | Use and store according to specifications, will no |
| HTC | 2922299090 |
| SMILES | Nc1cccc2c(O)cc(S(=O)(=O)O)cc12 |
| InChI | InChI=1S/C10H9NO4S/c11-9-3-1-2-7-8(9)4-6(5-10(7)12)16(13,14)15/h1-5,12H,11H2,(H,13,14,15) |
| InChI Key | GGZZISOUXJHYOY-UHFFFAOYSA-N |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 97.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards 5-Amino-1-naphthol-3-sulfonic acid hydrate Modification number: 6 Module 14. Shipping information UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(p-Toluidino)naphthalene-6-sulfonicacidpotassiumsalt | 32752-10-6 | 2A-9084344 |
| 3-Amino-2-hydroxynaphthalene | 5417-63-0 | 2A-9084345 |
| 1,1'-Diamino-2,2'-dinaphthyldisulfide | 38262-57-6 | 2A-9084346 |
| 1,2-Diaminonaphthalene | 938-25-0 | 2A-9084347 |
| 1-(p-Toluidino)naphthalene | 634-43-5 | 2A-9084348 |
| Bis(4-N,N-Diethylaminophenyl)-(4-N-ethylaminonaphthalen-1-yl)acetonitrile | 57855-48-8 | 2A-9084353 |
| (+/-)-2-Amino-6,7-dihydroxy-1,2,3,4-tetrahydronaphthaleneHBr | 73304-33-3 | 2A-9084354 |
| Bov-Phe(3,5-Dii,4-NH2)-OH | 67230-47-1 | 2A-9084355 |
| Diethylbenzamidomalonate | 16798-45-1 | 2A-9084356 |
| N-(4-Chloro-2-methylphenyl)-3-(phosphonooxy)naphthalene-2-carboxamide | 2616-72-0 | 2A-9084359 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA