
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 634-43-5 |
| Catalog No. | 2A-9084348 |
| Chinese Name | N-(对甲苯基)-1-萘胺 |
| Synonyms | N-(4-methylphenyl)naphthalen-1-amine |
| Molecular Formula | C17H15N1 |
| Molecular Weight | 233.31 |
| Density | 1.133g/cm3 |
| Boiling Point | 360ºC / 528mmHg |
| Melting Point | 78ºC |
| Storage Condition | Store in an airtight container filled with argon a |
| HTC | 2921499090 |
| MDL Number | MFCD00035709 |
| SMILES | Cc1ccc(Nc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C17H15N/c1-13-9-11-15(12-10-13)18-17-8-4-6-14-5-2-3-7-16(14)17/h2-12,18H,1H3 |
| InChI Key | RWYRKFWBKGQTLU-UHFFFAOYSA-N |
| MSDS | msds/84348_1_634_43_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 96.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1-Amino-4-chloronaphthalene | 4684-12-2 | 2A-9084343 |
| 2-(p-Toluidino)naphthalene-6-sulfonicacidpotassiumsalt | 32752-10-6 | 2A-9084344 |
| 3-Amino-2-hydroxynaphthalene | 5417-63-0 | 2A-9084345 |
| 1,1'-Diamino-2,2'-dinaphthyldisulfide | 38262-57-6 | 2A-9084346 |
| 1,2-Diaminonaphthalene | 938-25-0 | 2A-9084347 |
| 1-Amino-5-naphthol-7-sulfonicacid | 489-78-1 | 2A-9084349 |
| Bis(4-N,N-Diethylaminophenyl)-(4-N-ethylaminonaphthalen-1-yl)acetonitrile | 57855-48-8 | 2A-9084353 |
| (+/-)-2-Amino-6,7-dihydroxy-1,2,3,4-tetrahydronaphthaleneHBr | 73304-33-3 | 2A-9084354 |
| Bov-Phe(3,5-Dii,4-NH2)-OH | 67230-47-1 | 2A-9084355 |
| Diethylbenzamidomalonate | 16798-45-1 | 2A-9084356 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA