
Please Login or Create an Account to: See VlP prices and availability
US Stock: ship in 0-1 business day
Global Stock: ship in 5-7 days
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 14603-76-0 |
| Catalog No. | 2A-9084320 |
| Chinese Name | (R)-(-)-2-氨基-2-甲基丁二酸 |
| Synonyms | (2R)-2-azaniumyl-2-methylbutanedioate |
| Molecular Formula | C5H9NO4 |
| Molecular Weight | 194.18 |
| Purity | ≥99.0 (sum of enantiomers, HPLC) |
| Boiling Point | 259.2ºC at 760mmHg |
| Melting Point | 165-169 °C |
| Appearance | crystalline powder |
| EINECS | 202-571-3 |
| PubChem ID | 329760337 |
| MDL Number | MFCD00064086 |
| SMILES | CO[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | 1S/C7H14O6/c1-12-7-6(11)5(10)4(9)3(2-8)13-7/h3-11H,2H2,1H3/t3-,4-,5+,6-,7+/m1/s1 |
| InChI Key | HOVAGTYPODGVJG-ZFYZTMLRSA-N |
| Beilstein/REAXYS | 81568 |
| NACRES Code | NA.74 |
| UNSPSC | 41106212 |
| MSDS | msds/84320_1_14603_76_0.pdf |
| Transport Info | Product name: H-α-Me-D-Asp-OH |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2,3,5,6-Tetrafluoro-4-aminobenzotrifluoride | 651-83-2 | 2A-9084310 |
| 2-(1,1,2,2-Tetrafluoroethoxy)aniline | 35295-34-2 | 2A-9084311 |
| 3-(1,1,2,2-Tetrafluoroethoxy)aniline | 831-75-4 | 2A-9084312 |
| 4-(1,1,2,2-Tetrafluoroethoxy)aniline | 713-62-2 | 2A-9084313 |
| alpha-Methyl-L-Asp | 3227-17-6 | 2A-9084319 |
| 1-Methyl-3,3-diphenylpropylamine | 15793-40-5 | 2A-9084321 |
| TranylcyprominieHydrochloride | 1986-47-6 | 2A-9084323 |
| 3,3'-Diaminodiphenylmethane | 19471-12-6 | 2A-9084325 |
| 4,4'-Cyclohexylidenedionline | 3282-99-3 | 2A-9084327 |
| N-monoacetyl-4,4'-diaminodiphenylsulfone | 565-20-8 | 2A-9084328 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA