
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 6317-73-3 |
| Catalog No. | 2A-9084182 |
| Chinese Name | 4-苯氧基二苯甲酮 |
| Synonyms | MFCD00017553; (4-phenoxyphenyl)-phenylmethanone |
| Molecular Formula | C19H14O2 |
| Molecular Weight | 274.31300 |
| Density | 1.151g/cm3 |
| Boiling Point | 414.1ºC at 760 mmHg |
| Melting Point | 64°C |
| Storage Condition | Avoid light, keep in a cool and dry place, sealed |
| HTC | 2914509090 |
| SMILES | O=C(c1ccccc1)c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C19H14O2/c20-19(15-7-3-1-4-8-15)16-11-13-18(14-12-16)21-17-9-5-2-6-10-17/h1-14H |
| InChI Key | ITVUPWDTDWMACZ-UHFFFAOYSA-N |
| MSDS | msds/84182_1_6317_73_3.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,3-Dimethylnaphthalene | 575-41-7 | 2A-9084177 |
| 2,3-Dimethylnaphthalene | 581-40-8 | 2A-9084178 |
| 2-Nitronaphthalene | 581-89-5 | 2A-9084179 |
| 2,2'-(Bisacrylamino)diethyldisulfide | 60984-57-8 | 2A-9084180 |
| 4-Iodobenzophenone | 6136-66-9 | 2A-9084181 |
| 4-Benzoyl-4'-bromobiphenyl | 63242-14-8 | 2A-9084183 |
| 2,2-Dichlorocyclopropylphenylsulfide | 63289-85-0 | 2A-9084184 |
| 2-Naphthylphenylketone | 644-13-3 | 2A-9084185 |
| 3-Chloro-4'-methoxy-3'-nitrobenzophenone | 66938-41-8 | 2A-9084187 |
| 2-Acetamidobenzophenone | 85-99-4 | 2A-9084188 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA