
CAS Number581-89-5
SynonymsEINECS 209-474-5; MFCD00004055; 2-Nitronaphthalene; β-Nitronaphthalene
Molecular FormulaC10H8N2O2
Molecular Weight188.187
Density1.3±0.1 g/cm3
Boiling Point319.6±11.0 °C at 760 mmHg
Melting Point65-73 °C
AppearanceYellow to brown solid
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 581-89-5 |
| Catalog No. | 2A-9084179 |
| Chinese Name | 2-硝基萘 |
| Synonyms | EINECS 209-474-5; MFCD00004055; 2-Nitronaphthalene; β-Nitronaphthalene |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.187 |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 319.6±11.0 °C at 760 mmHg |
| Melting Point | 65-73 °C |
| Appearance | Yellow to brown solid |
| Storage Condition | Storage precautions: Store in a cool, ventilated w |
| Packaging | III |
| HTC | 2904209090 |
| MDL Number | MFCD00021462 |
| SMILES | O=[N+]([O-])c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H7NO2/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10/h1-7H |
| InChI Key | ZJYJZEAJZXVAMF-UHFFFAOYSA-N |
| Hazard Symbols | 4.1 |
| MSDS | msds/84179_1_581_89_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2904209090 derivatives containing only nitro or only nitroso groups. Supervision conditions:None. VAT: 17.0%. Tax rebate rate:9.0%. MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,4-Dimethylnaphthalene | 571-58-4 | 2A-9084174 |
| 1,5-Dimethylnaphthalene | 571-61-9 | 2A-9084175 |
| 1,2-Dimethylnaphthalene | 573-98-8 | 2A-9084176 |
| 1,3-Dimethylnaphthalene | 575-41-7 | 2A-9084177 |
| 2,3-Dimethylnaphthalene | 581-40-8 | 2A-9084178 |
| 2,2'-(Bisacrylamino)diethyldisulfide | 60984-57-8 | 2A-9084180 |
| 4-Iodobenzophenone | 6136-66-9 | 2A-9084181 |
| 4-Phenoxybenzophenone | 6317-73-3 | 2A-9084182 |
| 4-Benzoyl-4'-bromobiphenyl | 63242-14-8 | 2A-9084183 |
| 2,2-Dichlorocyclopropylphenylsulfide | 63289-85-0 | 2A-9084184 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA