
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4049-39-2 |
| Catalog No. | 2A-9084059 |
| Chinese Name | 3-羟基-4-苄氧基苯甲醛 |
| Synonyms | 3-hydroxy-4-phenylmethoxybenzaldehyde; 4-(Benzyloxy)-3-hydroxybenzaldehyde; 3-Hydroxy-4-benzyloxy benzaldehyde |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.25 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 403.3±30.0 °C at 760 mmHg |
| Storage Condition | 2-8°C, store in inert gas |
| HTC | 2912499000 |
| MDL Number | MFCD03840812 |
| SMILES | O=Cc1ccc(OCc2ccccc2)c(O)c1 |
| InChI Key | HUNGEAFDVLSPAM-UHFFFAOYSA-N |
| MSDS | msds/84059_1_4049_39_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 3-(3-Methylphenyl)benzaldehyde | 216443-78-6 | 2A-9084052 |
| 3-(4-Methylphenyl)benzaldehyde | 116470-54-3 | 2A-9084053 |
| 3-(4-Methoxyphenyl)benzaldehyde | 118350-17-7 | 2A-9084054 |
| 3-(2-Methoxyphenyl)benzaldehyde | 122801-57-4 | 2A-9084055 |
| 2-Chloro-3-hydroxy-4-methoxybenzaldehyde | 37687-57-3 | 2A-9084057 |
| 4-(3,3-Dimethyl-1-butynyl)-benzaldehyde | 173592-71-7 | 2A-9084060 |
| 2,5-Disulphobenzaldehyde | 51818-11-2 | 2A-9084061 |
| 3-(Methoxymethoxy)benzaldehyde | 13709-05-2 | 2A-9084062 |
| 3-(3-Hydroxy-prop-1-ynyl)-benzaldehyde | 170859-74-2 | 2A-9084063 |
| 2-Ethynylbenzaldehyde | 38846-64-9 | 2A-9084065 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA