
CAS Number122801-57-4
SynonymsMFCD03424640; [1,1'-Biphenyl]-3-carboxaldehyde,2'-methoxy; 2'-methoxy-(1,1'-biphenyl)-3-carbaldehyde; 3-formyl-2'-methoxybiphenyl; 2'-methoxy-[1,1'-biphenyl]-3-carboxaldehyde; 2'-Methoxy-biphenyl-3-carbaldehyde; AMTDA119; 2-methoxy-3'-formylbiphenyl
Molecular FormulaC14H12O2
Molecular Weight212.24400
Density1.114g/cm3
Boiling Point332.9ºC at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 122801-57-4 |
| Catalog No. | 2A-9084055 |
| Chinese Name | 3-(2-甲氧基苯基)苯甲醛 |
| Synonyms | MFCD03424640; [1,1'-Biphenyl]-3-carboxaldehyde,2'-methoxy; 2'-methoxy-(1,1'-biphenyl)-3-carbaldehyde; 3-formyl-2'-methoxybiphenyl; 2'-methoxy-[1,1'-biphenyl]-3-carboxaldehyde; 2'-Methoxy-biphenyl-3-carbaldehyde; AMTDA119; 2-methoxy-3'-formylbiphenyl |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.24400 |
| Density | 1.114g/cm3 |
| Boiling Point | 332.9ºC at 760 mmHg |
| Storage Condition | 2-8°C, inert atmosphere |
| HTC | 2922299090 |
| SMILES | COc1ccccc1-c1cccc(C=O)c1 |
| InChI | InChI=1S/C14H12O2/c1-16-14-8-3-2-7-13(14)12-6-4-5-11(9-12)10-15/h2-10H,1H3 |
| InChI Key | OIJZSURASXVTDU-UHFFFAOYSA-N |
| MSDS | msds/84055_1_122801_57_4.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-Difluoromethoxy-3-methoxy-benzaldehyde | 162401-70-9 | 2A-9084050 |
| 4-(3-Methylphenyl)benzaldehyde | 400744-83-4 | 2A-9084051 |
| 3-(3-Methylphenyl)benzaldehyde | 216443-78-6 | 2A-9084052 |
| 3-(4-Methylphenyl)benzaldehyde | 116470-54-3 | 2A-9084053 |
| 3-(4-Methoxyphenyl)benzaldehyde | 118350-17-7 | 2A-9084054 |
| 2-Chloro-3-hydroxy-4-methoxybenzaldehyde | 37687-57-3 | 2A-9084057 |
| 4-Hydroxy-4-benzyloxybenzaldehyde | 4049-39-2 | 2A-9084059 |
| 4-(3,3-Dimethyl-1-butynyl)-benzaldehyde | 173592-71-7 | 2A-9084060 |
| 2,5-Disulphobenzaldehyde | 51818-11-2 | 2A-9084061 |
| 3-(Methoxymethoxy)benzaldehyde | 13709-05-2 | 2A-9084062 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA