
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5397-82-0 |
| Catalog No. | 2A-9084020 |
| Chinese Name | 二苯并呋喃-2-甲醛 |
| Synonyms | dibenzofuran-2-carbaldehyde; Dibenzofuran-2-carboxaldehyde |
| Molecular Formula | C13H8O2 |
| Molecular Weight | 196.20100 |
| Density | 1.289 g/cm3 |
| Boiling Point | 360.5ºC at 760 mmHg |
| Melting Point | 74ºC |
| Appearance | Solid;White to Almost white powder to crystal |
| Storage Condition | Store under inert gas; avoid air |
| HTC | 2932999099 |
| SMILES | O=Cc1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C13H8O2/c14-8-9-5-6-13-11(7-9)10-3-1-2-4-12(10)15-13/h1-8H |
| InChI Key | OVJMIWIVPWPZMN-UHFFFAOYSA-N |
| MSDS | msds/84020_1_5397_82_0.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 5-Piperidin-1-ylmethyl-furan-2-carboxylicacid | 301353-36-6 | 2A-9084012 |
| 6,7-Dihydroxy-3,4-dihydroisoquinoline | 4602-83-9 | 2A-9084013 |
| 7-Ethoxybenzofuran-2-carboxylicacid | 206559-61-7 | 2A-9084016 |
| Benzo[B]naphtho[1,2-D]Furan | 205-39-0 | 2A-9084017 |
| Benzo[b]naphtho[2,3-d]furan | 243-42-5 | 2A-9084018 |
| N-(Furan-2-ylmethyl)-4-methoxyaniline | 17377-97-8 | 2A-9084022 |
| Furan-2-Ylmethyl-(4-Methoxy-Benzyl)-Amine | 225236-03-3 | 2A-9084023 |
| furan-2-ylmethyl-P-totyl-amine | 3139-27-3 | 2A-9084024 |
| Methyl2,5-dihydro-2,5-dimethoxy-2-furancarboxylate | 62435-72-7 | 2A-9084025 |
| N-(2-Hydroxypropyl)thiomorpholine | 6007-66-5 | 2A-9084026 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA