CAS Number4602-83-9
Synonyms6,7-Dihydroxy-3,4-dihydroisoquinoline; 3,4-dihydroisoquinoline-6,7-diol; 7-hydroxy-3,4-dihydro-2H-isoquinolin-6-one; MFCD00143490; 3,4-Dihydro-6,7-isoquinolinediol
Molecular FormulaC9H9NO2
Molecular Weight163.173
Density1.4±0.1 g/cm3
Boiling Point396.4±42.0 °C at 760 mmHg
Melting Point244-248ºC
AppearanceYellow to brown crystalline powder or tablets
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 4602-83-9 |
| Catalog No. | 2A-9084013 |
| Chinese Name | 6,7-二羟基-3,4-二氢异喹啉 |
| Synonyms | 6,7-Dihydroxy-3,4-dihydroisoquinoline; 3,4-dihydroisoquinoline-6,7-diol; 7-hydroxy-3,4-dihydro-2H-isoquinolin-6-one; MFCD00143490; 3,4-Dihydro-6,7-isoquinolinediol |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.173 |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 396.4±42.0 °C at 760 mmHg |
| Melting Point | 244-248ºC |
| Appearance | Yellow to brown crystalline powder or tablets |
| Storage Condition | Store airtight in a cool, dry warehouse. |
| HTC | 2933499090 |
| SMILES | Oc1cc2c(cc1O)CCN=C2 |
| InChI | InChI=1S/C9H9NO2/c11-8-3-6-1-2-10-5-7(6)4-9(8)12/h3-5,10,12H,1-2H2 |
| InChI Key | PWCQVMIYUGOTLG-UHFFFAOYSA-N |
| MSDS | msds/84013_1_4602_83_9.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 5-Bromoperhydroisoquinolinehydrobromide | 90435-92-0 | 2A-9083989 |
| 5-Chloro-1,3-dimethyl-4-nitro-1H-pyrazole | 13551-73-0 | 2A-9083990 |
| 5-Methoxybenzofuran-2-carboxylicacid,ethylester | 50551-56-9 | 2A-9083993 |
| 5-Phenyl-2-furancarboxylicacid | 52938-97-3 | 2A-9084011 |
| 5-Piperidin-1-ylmethyl-furan-2-carboxylicacid | 301353-36-6 | 2A-9084012 |
| 7-Ethoxybenzofuran-2-carboxylicacid | 206559-61-7 | 2A-9084016 |
| Benzo[B]naphtho[1,2-D]Furan | 205-39-0 | 2A-9084017 |
| Benzo[b]naphtho[2,3-d]furan | 243-42-5 | 2A-9084018 |
| Dibenzofuran-2-carboxaldehyde | 5397-82-0 | 2A-9084020 |
| N-(Furan-2-ylmethyl)-4-methoxyaniline | 17377-97-8 | 2A-9084022 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS