
CAS Number24083-13-4
Synonymsp-n-octyloxybenzaldehyde; 4-Octyloxybenzaldehyde; 4-(Octyloxy)benzaldehyde; p-Octyloxybenzaldehyde; 4-n-Octyloxybenzaldehyde; EINECS 246-012-1; MFCD00014136
Molecular FormulaC15H22O2
Molecular Weight234.34
Density1.0±0.1 g/cm3
Boiling Point349.9±15.0 °C at 760 mmHg
AppearanceTransparent colorless to light yellow liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 24083-13-4 |
| Catalog No. | 2A-9083983 |
| Chinese Name | 4-正辛氧基苯甲醛 |
| Synonyms | p-n-octyloxybenzaldehyde; 4-Octyloxybenzaldehyde; 4-(Octyloxy)benzaldehyde; p-Octyloxybenzaldehyde; 4-n-Octyloxybenzaldehyde; EINECS 246-012-1; MFCD00014136 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 349.9±15.0 °C at 760 mmHg |
| Appearance | Transparent colorless to light yellow liquid |
| Storage Condition | Keep receptacles sealed Place in a tight container |
| HTC | 2912499000 |
| MDL Number | MFCD00014136 |
| SMILES | CCCCCCCCOc1ccc(C=O)cc1 |
| InChI | InChI=1S/C15H22O2/c1-2-3-4-5-6-7-12-17-15-10-8-14(13-16)9-11-15/h8-11,13H,2-7,12H2,1H3 |
| InChI Key | KVOWZHASDIKNFK-UHFFFAOYSA-N |
| MSDS | msds/83983_1_24083_13_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 2-Allylpxybenzaldehyde | 28752-82-1 | 2A-9083974 |
| O-Hexyloxybenzaldehyde | 7162-59-6 | 2A-9083976 |
| Benzaldehydenitrogenmustard | 1208-03-3 | 2A-9083978 |
| 4-Allyloxybenzaldehyde | 40663-68-1 | 2A-9083980 |
| 4-Amyloxybenzaldehyde | 5736-91-4 | 2A-9083982 |
| 5-(Dimethylamino)-2-furaldehyde | 3680-93-1 | 2A-9083984 |
| 2-Benzyloxy-4,5-dimethoxybenzaldehyde | 14382-86-6 | 2A-9083985 |
| Pentamethylbenzaldehyde | 17432-38-1 | 2A-9083991 |
| 2-Ethoxy-M-anisaldehyde | 66799-97-1 | 2A-9083992 |
| 2-Ethoxy-4-anisaldehyde | 42924-37-8 | 2A-9083994 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA