
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 5736-91-4 |
| Catalog No. | 2A-9083982 |
| Chinese Name | 4-戊氧基苯甲醛 |
| Synonyms | EINECS 227-250-5; 4-pentyloxybenzaldehyde; p-Pentyloxybenzaldehyde; 4-Pentoxybenzaldehyde; 4-(Pentyloxy)benzaldehyde; MFCD00014135 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 303.6±15.0 °C at 760 mmHg |
| Storage Condition | Avoid light, keep in a cool and dry place, sealed |
| HTC | 2912499000 |
| MDL Number | MFCD00014135 |
| SMILES | CCCCCOc1ccc(C=O)cc1 |
| InChI | InChI=1S/C12H16O2/c1-2-3-4-9-14-12-7-5-11(10-13)6-8-12/h5-8,10H,2-4,9H2,1H3 |
| InChI Key | YAPVGSXODFOBBR-UHFFFAOYSA-N |
| MSDS | msds/83982_1_5736_91_4.pdf |
| Tax Rebate | 9.0% |
| Supervision | None. MFN tariff: 5.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Functional Building Blocks | ||
|---|---|---|
| 4-(Diethoxymethyl)benzaldehyde | 81172-89-6 | 2A-9083967 |
| 2-Allylpxybenzaldehyde | 28752-82-1 | 2A-9083974 |
| O-Hexyloxybenzaldehyde | 7162-59-6 | 2A-9083976 |
| Benzaldehydenitrogenmustard | 1208-03-3 | 2A-9083978 |
| 4-Allyloxybenzaldehyde | 40663-68-1 | 2A-9083980 |
| 4-Octyloxybenzaldehyde | 24083-13-4 | 2A-9083983 |
| 5-(Dimethylamino)-2-furaldehyde | 3680-93-1 | 2A-9083984 |
| 2-Benzyloxy-4,5-dimethoxybenzaldehyde | 14382-86-6 | 2A-9083985 |
| Pentamethylbenzaldehyde | 17432-38-1 | 2A-9083991 |
| 2-Ethoxy-M-anisaldehyde | 66799-97-1 | 2A-9083992 |
| Browse all Functional Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA