
CAS Number1746-11-8
Synonyms2-Methylcoumaran; 3-methyl-2,3-dihydrobenzofuran; Benzofuran,2,3-dihydro-2-methyl; 2,3-Dihydro-2-methylbenzofuran; 2-Methyl-2,3-dihydro-1-benzofuran; rac-2-methyl-2,3-dihydrobenzofuran; 2-Methyl-2,3-dihydrobenzofuran; EINECS 217-124-8; MFCD00023003
Molecular FormulaC9H10O1
Molecular Weight134.18
Density1.0±0.1 g/cm3
Boiling Point197.4±10.0 °C at 760 mmHg
AppearanceLiquid;Colorless to Almost colorless clear liquid
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 1746-11-8 |
| Catalog No. | 2A-9083919 |
| Chinese Name | 2,3-二氢-2-甲基苯并呋喃 |
| Synonyms | 2-Methylcoumaran; 3-methyl-2,3-dihydrobenzofuran; Benzofuran,2,3-dihydro-2-methyl; 2,3-Dihydro-2-methylbenzofuran; 2-Methyl-2,3-dihydro-1-benzofuran; rac-2-methyl-2,3-dihydrobenzofuran; 2-Methyl-2,3-dihydrobenzofuran; EINECS 217-124-8; MFCD00023003 |
| Molecular Formula | C9H10O1 |
| Molecular Weight | 134.18 |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 197.4±10.0 °C at 760 mmHg |
| Appearance | Liquid;Colorless to Almost colorless clear liquid |
| Storage Condition | room temperature |
| Packaging | III |
| HTC | 2932999099 |
| MDL Number | MFCD00023003 |
| SMILES | CC1Cc2ccccc2O1 |
| InChI | InChI=1S/C9H10O/c1-7-6-8-4-2-3-5-9(8)10-7/h2-5,7H,6H2,1H3 |
| InChI Key | BWCJVGMZEQDOMY-UHFFFAOYSA-N |
| MSDS | msds/83919_1_1746_11_8.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 20.0% |
| Transport Info | Product name: Purity: 98.0% |
| MSDS Transport Info | Module 14. Shipping information United Nations classification: inconsistent with United Nations classification standards UN number: not specified |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 3-Nitroquinoline | 17576-53-3 | 2A-9083888 |
| 1,5-Bis-(2-furanyl)-1,4-pentadien-3-one | 886-77-1 | 2A-9083908 |
| 1-Benzyl-1,2,3-triazole-4,5-dicarboxylicacid | 73953-89-6 | 2A-9083910 |
| 1-Isoquinolinemethanol | 27311-63-3 | 2A-9083912 |
| 2,3-Dibromofuran | 30544-34-4 | 2A-9083917 |
| 2,5-Dimethoxy-3-tetrahydrofurancarboxaldehyde | 50634-05-4 | 2A-9083925 |
| 2-[(2,5-Dimethyl-furan-3-carbonyl)-amino]-benzoicacid | 357420-38-3 | 2A-9083928 |
| 2-Methyl-3-furancarboxylicacidethylester | 28921-35-9 | 2A-9083933 |
| 2-Methyl-5-propionylfuran | 10599-69-6 | 2A-9083935 |
| Ethyl4-hydroxy-6-(trifluoromethoxy)quinoline-3-carboxylate | 175203-85-7 | 2A-9083938 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA