
CAS Number886-77-1
SynonymsDIFA; 1,5-di-2-furanyl-4-pentadien-3-one; 1,5-di-2-furanyl-1,4-pentadien-3-one; EINECS 212-955-2; Difurfurylideneacetone; 1,5-Difuryl-1,4-pentadien-3-one; 1,5-di-furan-2-yl-penta-1,4-dien-3-one; 1,5-di-2-furyl-4-pentadien-3-one; 1,3-difurfurylideneacetone; 1,5-di-2-furylpenta-1,4-dien-3-one; 1,5-di-2-furyl-3-pentadienon
Molecular FormulaC13H10O3
Molecular Weight214.22
Density1.2g/cm3
Boiling Point347.9ºC at 760 mmHg
Melting Point51-55ºC
AppearanceOrange-brown to red-brown crystalline powder
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 886-77-1 |
| Catalog No. | 2A-9083908 |
| Chinese Name | 1,5-双-(2-呋喃)-1,4-戊二烯-3-酮 |
| Synonyms | DIFA; 1,5-di-2-furanyl-4-pentadien-3-one; 1,5-di-2-furanyl-1,4-pentadien-3-one; EINECS 212-955-2; Difurfurylideneacetone; 1,5-Difuryl-1,4-pentadien-3-one; 1,5-di-furan-2-yl-penta-1,4-dien-3-one; 1,5-di-2-furyl-4-pentadien-3-one; 1,3-difurfurylideneacetone; 1,5-di-2-furylpenta-1,4-dien-3-one; 1,5-di-2-furyl-3-pentadienon |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.22 |
| Density | 1.2g/cm3 |
| Boiling Point | 347.9ºC at 760 mmHg |
| Melting Point | 51-55ºC |
| Appearance | Orange-brown to red-brown crystalline powder |
| Storage Condition | Store airtight in a cool, dry warehouse. |
| HTC | 2932190090 |
| MDL Number | MFCD00030601 |
| SMILES | O=C(C=Cc1ccco1)C=Cc1ccco1 |
| InChI | InChI=1S/C13H10O3/c14-11(5-7-12-3-1-9-15-12)6-8-13-4-2-10-16-13/h1-10H/b7-5+,8-6+ |
| InChI Key | XOOFLVNFEPIPIW-KQQUZDAGSA-N |
| MSDS | msds/83908_1_886_77_1.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 6.5% Ordinary tariff: 20.0% |
| Transport Info | Product name: Summary 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Heterocyclic Building Blocks | ||
|---|---|---|
| 3-Hydroxy-5-methoxy(1H)indazole | 99719-37-6 | 2A-9083873 |
| 4-Pyridinecarbonylchloride | 99911-04-3 | 2A-9083875 |
| 2-Thiophenecarboxylicacidsodiumsalt | 25112-68-9 | 2A-9083877 |
| 5-Chloro-4-nitro-2,1,3-benzothiadiazole | 2274-89-7 | 2A-9083884 |
| 3-Nitroquinoline | 17576-53-3 | 2A-9083888 |
| 1-Benzyl-1,2,3-triazole-4,5-dicarboxylicacid | 73953-89-6 | 2A-9083910 |
| 1-Isoquinolinemethanol | 27311-63-3 | 2A-9083912 |
| 2,3-Dibromofuran | 30544-34-4 | 2A-9083917 |
| 2,3-Dihydro-2-methylbenzofuran | 1746-11-8 | 2A-9083919 |
| 2,5-Dimethoxy-3-tetrahydrofurancarboxaldehyde | 50634-05-4 | 2A-9083925 |
| Browse all Heterocyclic Building Blocks products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA