
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 653-11-2 |
| Catalog No. | 2A-9083712 |
| Chinese Name | 2,3,5,6-四氟苯肼 |
| Synonyms | EINECS 211-494-4; (2,3,5,6-tetrafluorophenyl)hydrazine; MFCD00007575 |
| Molecular Formula | C6H4N2F4 |
| Molecular Weight | 180.1 |
| Density | 1.595g/cm3 |
| Boiling Point | 136.3ºC at 760 mmHg |
| Melting Point | 91-93 °C(lit.) |
| Appearance | White to light yellow crystal powder |
| Storage Condition | Store at room temperature and pressure. |
| HTC | 2928000090 |
| MDL Number | MFCD00007575 |
| SMILES | NNc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C6H4F4N2/c7-2-1-3(8)5(10)6(12-11)4(2)9/h1,12H,11H2 |
| InChI Key | TYMFVEOXNZYYTF-UHFFFAOYSA-N |
| MSDS | msds/83712_1_653_11_2.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 4-(1,1,2,2-Tetrafluoroethoxy)benzoicacid | 10009-25-3 | 2A-9083705 |
| 2-(1,1,2,2-Tetrafluoroethoxy)nitrobenzene | 28202-31-5 | 2A-9083706 |
| 1,3,5-Tris(3-bromophenyl)benzene | 96761-85-2 | 2A-9083709 |
| 2,3,5,6-Tetrafluoro-4-methoxybenzylbromide | 4910-40-1 | 2A-9083710 |
| 2,3,5,6-Tetrafluoro-4-methylbenzoicacid | 652-32-4 | 2A-9083711 |
| 2,3,5,6-Tetrafluorothiophenol | 769-40-4 | 2A-9083714 |
| 4-Nitro-m-tolunitrile | 96784-54-2 | 2A-9083719 |
| 3,6-Dibromonaphthalene-2,7-diol | 96965-79-6 | 2A-9083721 |
| DL-Cysteinehydrochloridehydrate | 96998-61-7 | 2A-9083722 |
| 3,5-Dibromobenzonitrile | 97165-77-0 | 2A-9083724 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA