
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 28202-31-5 |
| Catalog No. | 2A-9083706 |
| Chinese Name | 2-四氟乙氧基硝基苯 |
| Synonyms | 2-Tetrafluoroethoxynitrobenzene; EINECS 248-898-5; PC6774; MFCD00042445 |
| Molecular Formula | C9H4O1N1Br1F4 |
| Molecular Weight | 298.03 |
| Density | 1,471 g/cm3 |
| Boiling Point | 66-68°C 1mm |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2909309090 |
| MDL Number | MFCD31656070 |
| SMILES | O=[N+]([O-])c1ccccc1OC(F)(F)C(F)F |
| InChI | InChI=1S/C8H5F4NO3/c9-7(10)8(11,12)16-6-4-2-1-3-5(6)13(14)15/h1-4,7H |
| InChI Key | NZPNQVWBJNSDMV-UHFFFAOYSA-N |
| MSDS | msds/83706_1_28202_31_5.pdf |
| Tax Rebate | 9.0% |
| Supervision | none |
| Transport Info | Product name: Summary 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 2-(1,1,2,2-Tetrafluoroethoxy)benzoicacid | 10008-97-6 | 2A-9083701 |
| Methyl(p-formylphenyl)acetate | 96524-70-8 | 2A-0202509 |
| 3-(1,1,2,2,-Tetrafluoroethoxy)benzoicacid | 70126-48-6 | 2A-9083703 |
| 2-Bromo-3-chloroaniline | 96558-73-5 | 2A-9083704 |
| 4-(1,1,2,2-Tetrafluoroethoxy)benzoicacid | 10009-25-3 | 2A-9083705 |
| 1,3,5-Tris(3-bromophenyl)benzene | 96761-85-2 | 2A-9083709 |
| 2,3,5,6-Tetrafluoro-4-methoxybenzylbromide | 4910-40-1 | 2A-9083710 |
| 2,3,5,6-Tetrafluoro-4-methylbenzoicacid | 652-32-4 | 2A-9083711 |
| 2,3,5,6-Tetrafluorophenylhydrazine | 653-11-2 | 2A-9083712 |
| 2,3,5,6-Tetrafluorothiophenol | 769-40-4 | 2A-9083714 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA