CAS Number18066-68-7
SynonymsHomoveratric acid,ethyl ester; Ethyl 3,4-dimethoxyphenyl acetate; Ethyl dimethoxyphenylacetate; EINECS 241-974-9; Ethyl (3,4-dimethoxyphenyl)acetate; MFCD00017272; Benzeneacetic acid, 3,4-dimethoxy-, ethyl ester; Acetic acid, (3,4-dimethoxyphenyl)-, ethyl ester; Homoveratrumsaeureaethylester; Ethyl 3,4-dimethoxyphenylacetate; (3,4-dimethoxyphenyl)acetic acid ethyl ester; Benzeneacetic acid,3,4-dimethoxy-,ethyl ester; (3,4-Dimethoxy-phenyl)-essigsaeure-aethylester; Ethyl homoveratrate
Molecular FormulaC12H16O4
Molecular Weight224.259
Density1.1±0.1 g/cm3
Boiling Point302.0±27.0 °C at 760 mmHg
Symbol
Signal WordWarning
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 18066-68-7 |
| Catalog No. | 2A-9083485 |
| Chinese Name | 2-(3,4-二甲氧基苯基)乙酸乙酯 |
| Synonyms | Homoveratric acid,ethyl ester; Ethyl 3,4-dimethoxyphenyl acetate; Ethyl dimethoxyphenylacetate; EINECS 241-974-9; Ethyl (3,4-dimethoxyphenyl)acetate; MFCD00017272; Benzeneacetic acid, 3,4-dimethoxy-, ethyl ester; Acetic acid, (3,4-dimethoxyphenyl)-, ethyl ester; Homoveratrumsaeureaethylester; Ethyl 3,4-dimethoxyphenylacetate; (3,4-dimethoxyphenyl)acetic acid ethyl ester; Benzeneacetic acid,3,4-dimethoxy-,ethyl ester; (3,4-Dimethoxy-phenyl)-essigsaeure-aethylester; Ethyl homoveratrate |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.259 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 302.0±27.0 °C at 760 mmHg |
| Storage Condition | Sealed at room temperature, protected from light, |
| Packaging | III |
| HTC | 29211980 |
| MDL Number | MFCD00017272 |
| SMILES | CCOC(=O)Cc1ccc(OC)c(OC)c1 |
| InChI Key | WZKCZNJTDZCNMH-UHFFFAOYSA-N |
| Hazard Symbols | 6.1(b) |
| MSDS | msds/83485_1_18066_68_7.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| Di-2-pyridylthionocarbonate | 96989-50-3 | 2A-9083479 |
| 3-(4-Ethoxybenzoyl)propionicacid | 53623-37-3 | 2A-9083480 |
| 3-Ethoxy-4-methoxybenzoicacid | 2651-55-0 | 2A-9083481 |
| Ethyl4-acetamido-3-nitrobenzoate | 175204-17-8 | 2A-9083482 |
| Ethyl4-(benzyloxy)benzoate | 56441-55-5 | 2A-9083483 |
| Ethyl9-fluorenylideneacetate | 27973-36-0 | 2A-9083487 |
| 3-Ethyl-3-hexanol | 597-76-2 | 2A-9083488 |
| 4-Ethyl-3-hexanol | 19780-44-0 | 2A-9083489 |
| 2-Ethyl-1H-indene | 17059-50-6 | 2A-9083490 |
| Ethyl3-methoxyphenylacetate | 35553-92-5 | 2A-9083491 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA
EN
SDS