
CAS Number53623-37-3
Synonyms4-(4-ethoxy-phenyl)-4-oxo-butyric acid; 4-oxo-4-(4-ethoxyphenyl)butanoic acid; 3-(p-Ethoxy-benzoyl)-propionsaeure; 4-(4-Aethoxy-phenyl)-4-oxo-buttersaeure; 3-<4-Aethoxy-benzoyl>-propionsaeure; 3-(4-ETHOXYBENZOYL)PROPIONIC ACID; MFCD00100659
Molecular FormulaC12H14O4
Molecular Weight222.243
Density1.175g/cm3
Boiling Point426.7ºC at 760mmHg
Melting Point136 °C
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 53623-37-3 |
| Catalog No. | 2A-9083480 |
| Chinese Name | 4-(4-乙氧基苯基)-4-氧丁酸 |
| Synonyms | 4-(4-ethoxy-phenyl)-4-oxo-butyric acid; 4-oxo-4-(4-ethoxyphenyl)butanoic acid; 3-(p-Ethoxy-benzoyl)-propionsaeure; 4-(4-Aethoxy-phenyl)-4-oxo-buttersaeure; 3-<4-Aethoxy-benzoyl>-propionsaeure; 3-(4-ETHOXYBENZOYL)PROPIONIC ACID; MFCD00100659 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.243 |
| Density | 1.175g/cm3 |
| Boiling Point | 426.7ºC at 760mmHg |
| Melting Point | 136 °C |
| Storage Condition | Keep the container sealed and stored in a cool, dr |
| HTC | 2918990090 |
| MDL Number | MFCD00100659 |
| SMILES | CCOc1ccc(C(=O)CCC(=O)O)cc1 |
| InChI Key | HXMFVOXVXQBEEJ-UHFFFAOYSA-N |
| MSDS | msds/83480_1_53623_37_3.pdf |
| Tax Rebate | 13.0% |
| Supervision | None. MFN tariff: 6.5%. Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Related Products in Specialty Chemicals | ||
|---|---|---|
| 1,9-Diphenyl-1,3,6,8-nonatetraen-5-one | 622-21-9 | 2A-9083475 |
| Diphenylphosphinamide | 5994-87-6 | 2A-9083476 |
| 2-Diphenylphosphino-1-naphthoicacid | 178176-80-2 | 2A-9083477 |
| Diphenyl(p-tolyl)phosphine | 1031-93-2 | 2A-9083478 |
| Di-2-pyridylthionocarbonate | 96989-50-3 | 2A-9083479 |
| 3-Ethoxy-4-methoxybenzoicacid | 2651-55-0 | 2A-9083481 |
| Ethyl4-acetamido-3-nitrobenzoate | 175204-17-8 | 2A-9083482 |
| Ethyl4-(benzyloxy)benzoate | 56441-55-5 | 2A-9083483 |
| Ethyl3,4-dimethoxyphenylacetate | 18066-68-7 | 2A-9083485 |
| Ethyl9-fluorenylideneacetate | 27973-36-0 | 2A-9083487 |
| Browse all Specialty Chemicals products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA