
CAS Number94608-23-8
Synonyms1,3-Dimethoxy-5-[(Z)-2-(4-methoxyphenyl)vinyl]benzene; 3,5,4'-Trimethoxystilbene; 1,3-dimethoxy-5-[(E)-2-(4-methoxyphenyl)ethenyl]benzene; 1,3-dimethoxy-5-[(Z)-2-(4-methoxyphenyl)ethenyl]benzene; 3,4',5-trimethoxystilbene; cis-4-methoxy-3',5'-dimethoxystilbene; 1,3-Dimethoxy-5-[(E)-2-(4-methoxyphenyl)vinyl]benzene; 1,3-Dimethoxy-5-[(E)-2-(4-methoxy-phenyl)-vinyl]-benzene
Molecular FormulaC17H18O3
Molecular Weight270.33
Density1.1±0.1 g/cm3
Boiling Point423.8±35.0 °C at 760 mmHg
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 94608-23-8 |
| Catalog No. | 2A-9083155 |
| Chinese Name | cis-trismethoxy Resveratrol |
| Synonyms | 1,3-Dimethoxy-5-[(Z)-2-(4-methoxyphenyl)vinyl]benzene; 3,5,4'-Trimethoxystilbene; 1,3-dimethoxy-5-[(E)-2-(4-methoxyphenyl)ethenyl]benzene; 1,3-dimethoxy-5-[(Z)-2-(4-methoxyphenyl)ethenyl]benzene; 3,4',5-trimethoxystilbene; cis-4-methoxy-3',5'-dimethoxystilbene; 1,3-Dimethoxy-5-[(E)-2-(4-methoxyphenyl)vinyl]benzene; 1,3-Dimethoxy-5-[(E)-2-(4-methoxy-phenyl)-vinyl]-benzene |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 423.8±35.0 °C at 760 mmHg |
| Storage Condition | -20°C, sealed, dry |
| Application | Cis-trimethoxyresveratrol is a potent antimitotic agent. Cis-trimethoxyresveratrol inhibits tubulin polymerization with an IC50 value of 4μM[1]. |
| MDL Number | C17H18O3 |
| SMILES | COc1ccc(C=Cc2cc(OC)cc(OC)c2)cc1 |
| InChI Key | GDHNBPHYVRHYCC-PLNGDYQASA-N |
| MSDS | msds/83155_1_94608_23_8.pdf |
| Transport Info | Product name: cis-trimethoxyresveratrol |
| Related Products in Botanical Reference Standards | ||
|---|---|---|
| 2'-Hydroxychalcone | 1214-47-7 | 2A-9081649 |
| 4-Butyl-4'-hydroxychalcone | 385810-21-9 | 2A-9081719 |
| cis-Stilbeneboronicacidpinacolester | 264144-59-4 | 2A-9081977 |
| 2-Chloro-4'-fluorochalcone | 28081-11-0 | 2A-9082004 |
| 4-Chloro-4'-fluorochalcone | 28081-12-1 | 2A-9082005 |
| Naphtholas-bibeta-D-galactopyranoside | 51349-63-4 | 2A-9083207 |
| Ecgonidinemethylestermesylate | 43021-26-7 | 2A-9083234 |
| 4-Fluorochalcone | 1608-51-1 | 2A-9083434 |
| 4-Methoxystilbene | 1142-15-0 | 2A-9083571 |
| 2-Nitrochalcone | 7473-93-0 | 2A-9083675 |
| Browse all Botanical Reference Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA