
| Chemical & Physical Properties | |
|---|---|
| CAS Number | 28081-11-0 |
| Catalog No. | 2A-9082004 |
| Chinese Name | 2-氯-4'-氟查耳酮 |
| Synonyms | MFCD00018312; 2-chloro-4'-fluorochalcone |
| Molecular Formula | C15H10ClFO |
| Molecular Weight | 260.698 |
| Density | 1.265g/cm3 |
| Boiling Point | 389.6ºC at 760mmHg |
| Melting Point | 86-90ºC |
| Storage Condition | Sealed in a cool, dry environment |
| HTC | 2914700090 |
| MDL Number | MFCD00018312 |
| SMILES | Fc1ccc(cc1)C(=O)\C=C\c2ccccc2Cl |
| InChI | InChI=1S/C15H10ClFO/c16-14-4-2-1-3-11(14)7-10-15(18)12-5-8-13(17)9-6-12/h1-10H/b10-7+ |
| InChI Key | InChIKey=VXYSLQXVRKLSBO-JXMROGBWSA-N |
| MSDS | msds/82004_1_28081_11_0.pdf |
| Tax Rebate | 9.0% |
| Supervision | None MFN tariff: 5.5% Ordinary tariff: 30.0% |
| Transport Info | Product name: Summary HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Related Products in Botanical Reference Standards | ||
|---|---|---|
| Methyl-2-deoxy-2-[[(phenylmethoxy)carbonyl]amino]-4,6-O-(phenylmethylene)-alpha-D-glucopyranoside | 60076-41-7 | 2A-9081106 |
| 2-Hydroxychalcone | 42224-53-3 | 2A-9081519 |
| 2'-Hydroxychalcone | 1214-47-7 | 2A-9081649 |
| 4-Butyl-4'-hydroxychalcone | 385810-21-9 | 2A-9081719 |
| cis-Stilbeneboronicacidpinacolester | 264144-59-4 | 2A-9081977 |
| 4-Chloro-4'-fluorochalcone | 28081-12-1 | 2A-9082005 |
| (Z)-3,5,4'-Trimethoxystilbene | 94608-23-8 | 2A-9083155 |
| Naphtholas-bibeta-D-galactopyranoside | 51349-63-4 | 2A-9083207 |
| Ecgonidinemethylestermesylate | 43021-26-7 | 2A-9083234 |
| 4-Fluorochalcone | 1608-51-1 | 2A-9083434 |
| Browse all Botanical Reference Standards products » | ||
Phone:
630-322-8886
630-322-8887
Email:
Office Locations:
Chicago, IL, USA
San Francisco, CA, USA